P450 Protein:
| P450 Symbol | cdmJ |
| Protein Name | Cytochrome P450 monooxygenase cdmJ |
| Uniprot ID | A0A3G9GNK2 |
| EC Number | 1.-.-.- |
| Species | Talaromyces verruculosus (Penicillium verruculosum) |
| Txid | 198730 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | Membrane; Single-pass membrane protein |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C25H30O6 + C21H26N7O17P3-4 + O2 + H+ → C25H30O7 + C21H25N7O17P3-3 + H2O |
| Reaction Type | Oxidation |
| Chemical Bond | CH2 |
| RheaID | 65336 |
cdmJ
Substrate Information:
| Substrate Name | Chrodrimanin T |
| Substrate Chemical Formula | C25H30O6 |
| Substrate PubChem CID | 154700460 |
| Substrate Smiles | C[C@@H]1[C@@H](C2=C(C(=CC3=C2C[C@@H]4[C@@](O3)(CC[C@@H]5[C@@]4(C=CC(=O)C5(C)C)C)C)O)C(=O)O1)O |
| Substrate Structure |
| Substrate Name | NADPH(4-) |
| Substrate Chemical Formula | C21H26N7O17P3-4 |
| Substrate PubChem CID | 15983949 |
| Substrate Smiles | C1C=CN(C=C1C(=O)N)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)([O-])OP(=O)([O-])OC[C@@H]3[C@H]([C@H]([C@@H](O3)N4C=NC5=C(N=CN=C54)N)OP(=O)([O-])[O-])O)O)O |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
| Substrate Name | H+ |
| Substrate Chemical Formula | H+ |
| Substrate PubChem CID | 1038 |
| Substrate CAS Number | 12408-02-5 |
| Substrate Smiles | [H+] |
| Substrate Structure |
Product Information:
| Product Name | Chrodrimanin A |
| Product Chemical Formula | C25H30O7 |
| Product PubChem CID | 101565497 |
| Product Smiles | C[C@@H]1[C@@H](C2=C(C(=CC3=C2C[C@H]4[C@]5(C=CC(=O)C([C@@H]5C[C@@H]([C@@]4(O3)C)O)(C)C)C)O)C(=O)O1)O |
| Product Structure |
| Product Name | NADP+ |
| Product Chemical Formula | C21H25N7O17P3-3 |
| Product PubChem CID | 162422398 |
| Product Smiles | C1=CC(=C[N+](=C1)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)([O-])OP(=O)([O-])OC[C@@H]3[C@H]([C@H]([C@@H](O3)N4C=NC5=C(N=CN=C54)N)O)OP(=O)([O-])[O-])O)O)C(=O)N |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Elucidation and Heterologous Reconstitution of Chrodrimanin B Biosynthesis. |
| PMID: | 30417647 |
| Journal: | Organic letters |
| Year: | 2018/12/7 |