P450 Protein:
| P450 Symbol | cyp27c1 |
| Protein Name | Cytochrome P450 27C1 |
| Uniprot ID | A8WGA0 |
| EC Number | 1.14.19.53 |
| Gene ID | 558396 |
| Species | Danio rerio (Zebrafish) (Brachydanio rerio) |
| Txid | 7955 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | Membrane |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C20H30O + Fe2S2 + O2 + H+ → C20H28O + Fe2S2 + H2O |
| Reaction Type | Oxidation |
| Chemical Bond | CH2-CH2 |
| RheaID | 50292 |
cyp27c1
Substrate Information:
| Substrate Name | All-Trans-Retinol |
| Substrate Chemical Formula | C20H30O |
| Substrate PubChem CID | 445354 |
| Substrate Smiles | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/CO)/C)/C |
| Substrate Structure |
| Substrate Name | [2Fe-2S]1+ |
| Substrate Chemical Formula | Fe2S2 |
| Substrate Smiles | S1[Fe]S[Fe+]1 |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
| Substrate Name | H+ |
| Substrate Chemical Formula | H+ |
| Substrate PubChem CID | 1038 |
| Substrate CAS Number | 12408-02-5 |
| Substrate Smiles | [H+] |
| Substrate Structure |
Product Information:
| Product Name | All-Trans-3,4-Didehydroretinol |
| Product Chemical Formula | C20H28O |
| Product PubChem CID | 6436043 |
| Product Smiles | CC1=C(C(CC=C1)(C)C)/C=C/C(=C/C=C/C(=C/CO)/C)/C |
| Product Structure |
| Product Name | [2Fe-2S]2+ |
| Product Chemical Formula | Fe2S2 |
| Product Smiles | S1[Fe+]S[Fe+]1 |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Cyp27c1 Red-Shifts the Spectral Sensitivity of Photoreceptors by Converting Vitamin A1 into A2. |
| PMID: | 26549260 |
| Journal: | Current biology : CB |
| Year: | 2015/12/7 |