Detail Information
P450 Protein:
| P450 Symbol | CYP260A1 |
| Protein Name | Cytochrome P450 CYP260A1 |
| Uniprot ID | A9FDB7 |
| EC Number | 1.14.15.19 |
| Species | Sorangium cellulosum (strain So ce56) (Polyangium cellulosum (strain So ce56)) |
| Txid | 448385 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | / |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C21H30O3 → C21H30O4 |
| Reaction Type | Oxidation |
| Chemical Bond | CH2 |
CYP260A1
Substrate Information:
| Substrate Name | 11-Deoxycorticosterone |
| Substrate Chemical Formula | C21H30O3 |
| Substrate PubChem CID | 5316556 |
| Substrate Smiles | C1C[C@@](C)2C3CC[C@@](C)4[C@@H](C(CO)=O)CCC4C3CCC2=CC1=O |
| Substrate Structure |
Product Information:
| Product Name | 1Alpha-Hydroxy-11-Deoxycorticosterone |
| Product Chemical Formula | C21H30O4 |
| Product Smiles | C1[C@H](O)[C@@](C)2C3CC[C@@](C)4[C@@H](C(CO)=O)CCC4C3CCC2=CC1=O |
| Product Structure |
References:
| Title: | Complete genome sequence of the myxobacterium Sorangium cellulosum. |
| PMID: | 17965706 |
| Journal: | Nature biotechnology |
| Year: | 2007/11/1 |
| Title: | Structural characterization of CYP260A1 from Sorangium cellulosum to investigate the 1α-hydroxylation of a mineralocorticoid. |
| PMID: | 27878817 |
| Journal: | FEBS letters |
| Year: | 2016/12/1 |
| Title: | Structure-Based Engineering of Steroidogenic CYP260A1 for Stereo- and Regioselective Hydroxylation of Progesterone. |
| PMID: | 29509407 |
| Journal: | ACS chemical biology |
| Year: | 2018/4/20 |