P450 Protein:
| P450 Symbol | cyp134 |
| Protein Name | Pulcherriminic acid synthase |
| Uniprot ID | O34926 |
| EC Number | 1.14.15.13 |
| Gene ID | 936624 |
| Species | Bacillus subtilis (strain 168) |
| Txid | 224308 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | / |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C12H22N2O2 + Fe2S2 + O2 + H+ → C12H20N2O4 + Fe2S2 + H2O |
| Reaction Type | Oxidation |
| Chemical Bond | NH-CH;-NH- |
| RheaID | 35555 |
cyp134
Substrate Information:
| Substrate Name | Cyclo(L-Leucyl-L-Leucyl) |
| Substrate Chemical Formula | C12H22N2O2 |
| Substrate PubChem CID | 192731 |
| Substrate Smiles | CC(C)C[C@H]1C(=O)N[C@H](C(=O)N1)CC(C)C |
| Substrate Structure |
| Substrate Name | [2Fe-2S]1+ |
| Substrate Chemical Formula | Fe2S2 |
| Substrate Smiles | S1[Fe]S[Fe+]1 |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
| Substrate Name | H+ |
| Substrate Chemical Formula | H+ |
| Substrate PubChem CID | 1038 |
| Substrate CAS Number | 12408-02-5 |
| Substrate Smiles | [H+] |
| Substrate Structure |
Product Information:
| Product Name | Pulcherriminic Acid |
| Product Chemical Formula | C12H20N2O4 |
| Product PubChem CID | 3083664 |
| Product Smiles | CC(C)CC1=C([N+](=C(C(=O)N1O)CC(C)C)[O-])O |
| Product Structure |
| Product Name | [2Fe-2S]2+ |
| Product Chemical Formula | Fe2S2 |
| Product Smiles | S1[Fe+]S[Fe+]1 |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Structural and biochemical characterization of the cytochrome P450 CypX (CYP134A1) from Bacillus subtilis: a cyclo-L-leucyl-L-leucyl dipeptide oxidase. |
| PMID: | 20690619 |
| Journal: | Biochemistry |
| Year: | 2010/8/31 |