Detail Information
P450 Protein:
| P450 Symbol | Cyp27b1 |
| Protein Name | 25-hydroxyvitamin D-1 alpha hydroxylase, mitochondrial |
| Uniprot ID | O35084 |
| EC Number | 1.14.15.18 |
| Gene ID | 13115 |
| Species | Mus musculus (Mouse) |
| Txid | 10090 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | Mitochondrion membrane |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C27H44O2 + C17H21N4O9P-2 + O2 + H+ → C27H44O3 + C17H18N4O9P-3 + H2O |
| Reaction Type | Oxidation |
| Chemical Bond | CH2 |
| RheaID | 20573 |
+
+
+
Cyp27b1
+
+
Substrate Information:
| Substrate Name | Calcidiol |
| Substrate Chemical Formula | C27H44O2 |
| Substrate PubChem CID | 5283731 |
| Substrate Smiles | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@H]2[C@@]1(CCC/C2=CC=C/3C[C@H](CCC3=C)O)C |
| Substrate Structure |
| Substrate Name | FMNH2 |
| Substrate Chemical Formula | C17H21N4O9P-2 |
| Substrate PubChem CID | 44229161 |
| Substrate Smiles | CC1=CC2=C(C=C1C)N(C3=C(N2)C(=O)NC(=O)N3)C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
| Substrate Name | H+ |
| Substrate Chemical Formula | H+ |
| Substrate PubChem CID | 1038 |
| Substrate CAS Number | 12408-02-5 |
| Substrate Smiles | [H+] |
| Substrate Structure |
Product Information:
| Product Name | Calcitriol |
| Product Chemical Formula | C27H44O3 |
| Product PubChem CID | 5280453 |
| Product Smiles | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@H]2[C@@]1(CCC/C2=CC=C/3C[C@H](C[C@@H](C3=C)O)O)C |
| Product Structure |
| Product Name | FMN |
| Product Chemical Formula | C17H18N4O9P-3 |
| Product PubChem CID | 44229199 |
| Product Smiles | CC1=CC2=C(C=C1C)N(C3=NC(=NC(=O)C3=N2)[O-])C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Enzymatic properties of mouse 25-hydroxyvitamin D3 1 alpha-hydroxylase expressed in Escherichia coli. |
| PMID: | 10092858 |
| Journal: | European journal of biochemistry |
| Year: | 1999/2/1 |
| Title: | Identification of the amino acid residue of CYP27B1 responsible for binding of 25-hydroxyvitamin D3 whose mutation causes vitamin D-dependent rickets type 1. |
| PMID: | 15972816 |
| Journal: | The Journal of biological chemistry |
| Year: | 2005/8/26 |