Detail Information
P450 Protein:
| P450 Symbol | CYP83B1 |
| Protein Name | Cytochrome P450 83B1 |
| Uniprot ID | O65782 |
| EC Number | 1.14.14.45 |
| Gene ID | 829277 |
| Species | Arabidopsis thaliana (Mouse-ear cress) |
| Txid | 3702 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | / |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C10H10N2O + C10H17N3O6S + C17H21N4O9P-2 + O2 → C20H24N5O7S- + C17H18N4O9P-3 + H2O + H+ |
| Reaction Type | Combination |
| Chemical Bond | OH;S |
| RheaID | 52180 |
+
+
+
CYP83B1
+
+
+
Substrate Information:
| Substrate Name | (E)-(Indol-3-yl)acetaldehyde oxime |
| Substrate Chemical Formula | C10H10N2O |
| Substrate PubChem CID | 5371769 |
| Substrate Smiles | C1=CC=C2C(=C1)C(=CN2)CC=NO |
| Substrate Structure |
| Substrate Name | Glutathione |
| Substrate Chemical Formula | C10H17N3O6S |
| Substrate PubChem CID | 124886 |
| Substrate Smiles | C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N |
| Substrate Structure |
| Substrate Name | FMNH2 |
| Substrate Chemical Formula | C17H21N4O9P-2 |
| Substrate PubChem CID | 44229161 |
| Substrate Smiles | CC1=CC2=C(C=C1C)N(C3=C(N2)C(=O)NC(=O)N3)C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
Product Information:
| Product Name | (E)-1-(Glutathione-S-Yl)-2-(1H-Indol-3-Yl)Acetohydroximate |
| Product Chemical Formula | C20H24N5O7S- |
| Product PubChem CID | 90658497 |
| Product Smiles | C1=CC=C2C(=C1)C(=CN2)C/C(=NO)/SC[C@@H](C(=O)NCC(=O)[O-])NC(=O)CC[C@@H](C(=O)[O-])[NH3+] |
| Product Structure |
| Product Name | FMN |
| Product Chemical Formula | C17H18N4O9P-3 |
| Product PubChem CID | 44229199 |
| Product Smiles | CC1=CC2=C(C=C1C)N(C3=NC(=NC(=O)C3=N2)[O-])C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
| Product Name | H+ |
| Product Chemical Formula | H+ |
| Product PubChem CID | 1038 |
| Product CAS Number | 12408-02-5 |
| Product Smiles | [H+] |
| Product Structure |
References:
| Title: | CYP83A1 and CYP83B1, two nonredundant cytochrome P450 enzymes metabolizing oximes in the biosynthesis of glucosinolates in Arabidopsis. |
| PMID: | 12970475 |
| Journal: | Plant physiology |
| Year: | 2003/9/1 |