P450 Protein:
| P450 Symbol | CYP107L1 |
| Protein Name | Cytochrome P450 monooxygenase PikC |
| Uniprot ID | O87605 |
| EC Number | 1.14.15.33 |
| Species | Streptomyces venezuelae |
| Txid | 54571 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | / |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C28H47NO7 + Fe2S2 + O2 + H+ → C28H47NO9 + Fe2S2 + H2O |
| Reaction Type | Oxidation |
| Chemical Bond | CH2;CH |
| RheaID | 40535 |
CYP107L1
Substrate Information:
| Substrate Name | Narbomycin |
| Substrate Chemical Formula | C28H47NO7 |
| Substrate PubChem CID | 5282036 |
| Substrate Smiles | CC[C@@H]1[C@@H](/C=C/C(=O)[C@@H](C[C@@H]([C@@H]([C@H](C(=O)[C@H](C(=O)O1)C)C)O[C@H]2[C@@H]([C@H](C[C@H](O2)C)N(C)C)O)C)C)C |
| Substrate Structure |
| Substrate Name | [2Fe-2S]1+ |
| Substrate Chemical Formula | Fe2S2 |
| Substrate Smiles | S1[Fe]S[Fe+]1 |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
| Substrate Name | H+ |
| Substrate Chemical Formula | H+ |
| Substrate PubChem CID | 1038 |
| Substrate CAS Number | 12408-02-5 |
| Substrate Smiles | [H+] |
| Substrate Structure |
Product Information:
| Product Name | Novapikromycin |
| Product Chemical Formula | C28H47NO9 |
| Product PubChem CID | 86289217 |
| Product Smiles | C[C@H]1C[C@H](C(=O)/C=C/[C@]([C@H](OC(=O)[C@@H](C(=O)[C@@H]([C@H]1O[C@H]2[C@@H]([C@H](C[C@H](O2)C)N(C)C)O)C)C)[C@@H](C)O)(C)O)C |
| Product Structure |
| Product Name | [2Fe-2S]2+ |
| Product Chemical Formula | Fe2S2 |
| Product Smiles | S1[Fe+]S[Fe+]1 |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Hydroxylation of macrolactones YC-17 and narbomycin is mediated by the pikC-encoded cytochrome P450 in Streptomyces venezuelae. |
| PMID: | 9831532 |
| Journal: | Chemistry & biology |
| Year: | 1998/11/1 |
| Title: | A gene cluster for macrolide antibiotic biosynthesis in Streptomyces venezuelae: architecture of metabolic diversity. |
| PMID: | 9770448 |
| Journal: | Proceedings of the National Academy of Sciences of the United States of America |
| Year: | 1998/10/13 |
| Title: | The structural basis for substrate anchoring, active site selectivity, and product formation by P450 PikC from Streptomyces venezuelae. |
| PMID: | 16825192 |
| Journal: | The Journal of biological chemistry |
| Year: | 2006/9/8 |
| Title: | Analysis of transient and catalytic desosamine-binding pockets in cytochrome P-450 PikC from Streptomyces venezuelae. |
| PMID: | 19124459 |
| Journal: | The Journal of biological chemistry |
| Year: | 2009/2/27 |
| Title: | Selective oxidation of carbolide C-H bonds by an engineered macrolide P450 mono-oxygenase. |
| PMID: | 19833867 |
| Journal: | Proceedings of the National Academy of Sciences of the United States of America |
| Year: | 2009/11/3 |
| Title: | Directing group-controlled regioselectivity in an enzymatic C-H bond oxygenation. |
| PMID: | 24627965 |
| Journal: | Jou |
| Year: | 2014/4/2 |