P450 Protein:
| P450 Symbol | CYP4B1 |
| Protein Name | Cytochrome P450 4B1 |
| Uniprot ID | P13584 |
| EC Number | 1.14.14.1 |
| Gene ID | 1580 |
| Species | Homo sapiens (Human) |
| Txid | 9606 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | Endoplasmic reticulum membrane; Peripheral membrane protein Microsome membrane; Peripheral membrane protein |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | HR + C17H21N4O9P-2 + O2 → HOR + C17H18N4O9P-3 + H2O + H+ |
| Reaction Type | Oxidation |
| Chemical Bond | CH3 |
| RheaID | 17149 |
CYP4B1
Substrate Information:
| Substrate Name | An Organic Molecule |
| Substrate Chemical Formula | HR |
| Substrate Smiles | *[H] |
| Substrate Structure |
| Substrate Name | FMNH2 |
| Substrate Chemical Formula | C17H21N4O9P-2 |
| Substrate PubChem CID | 44229161 |
| Substrate Smiles | CC1=CC2=C(C=C1C)N(C3=C(N2)C(=O)NC(=O)N3)C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
Product Information:
| Product Name | An Alcohol |
| Product Chemical Formula | HOR |
| Product PubChem SID | 8145368 |
| Product Smiles | O[*] |
| Product Structure |
| Product Name | FMN |
| Product Chemical Formula | C17H18N4O9P-3 |
| Product PubChem CID | 44229199 |
| Product Smiles | CC1=CC2=C(C=C1C)N(C3=NC(=NC(=O)C3=N2)[O-])C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
| Product Name | H+ |
| Product Chemical Formula | H+ |
| Product PubChem CID | 1038 |
| Product CAS Number | 12408-02-5 |
| Product Smiles | [H+] |
| Product Structure |
References:
| Title: | Identification of a new P450 expressed in human lung: complete cDNA sequence, cDNA-directed expression, and chromosome mapping. |
| PMID: | 2574990 |
| Journal: | Biochemistry |
| Year: | 1989/10/3 |
| Title: | cDNA cloning of cytochrome P-450 related to P-450p-2 from the cDNA library of human placenta. Gene structure and expression. |
| PMID: | 2298205 |
| Journal: | European journal of biochemistry |
| Year: | 1990/1/12 |
| Title: | Genetic polymorphism of the human cytochrome P450 CYP4B1: evidence for a non-functional allelic variant. |
| PMID: | 12142726 |
| Journal: | Pharmacogenetics |
| Year: | 2002/7/1 |
| Title: | Characterization of pulmonary CYP4B2, specific catalyst of methyl oxidation of 3-methylindole. |
| PMID: | 12695542 |
| Journal: | Molecular pharmacology |
| Year: | 2003/5/1 |
| Title: | The DNA sequence and biological annotation of human chromosome 1. |
| PMID: | 16710414 |
| Journal: | Nature |
| Year: | 2006/5/18 |
| Title: | The status, quality, and expansion of the NIH full-length cDNA project: the Mammalian Gene Collection (MGC). |
| PMID: | 15489334 |
| Journal: | Genome research |
| Year: | 2004/10/1 |