Detail Information
P450 Protein:
| P450 Symbol | CYP102A1 |
| Protein Name | Bifunctional cytochrome P450/NADPH--P450 reductase |
| Uniprot ID | P14779 |
| EC Number | 1.14.14.1; 1.6.2.4 |
| Gene ID | 93643681 |
| Species | Bacillus megaterium (strain ATCC 14581 / DSM 32 / JCM 2506 / NBRC 15308 / NCIMB 9376 / NCTC 10342 / NRRL B-14308 / VKM B-512) |
| Txid | 1348623 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | Cytoplasm |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | HR + C17H21N4O9P-2 + O2 → HOR + C17H18N4O9P-3 + H2O + H+ |
| Reaction Type | Oxidation |
| Chemical Bond | CH3 |
| RheaID | 17149 |
+
+
CYP102A1
+
+
+
Substrate Information:
| Substrate Name | An Organic Molecule |
| Substrate Chemical Formula | HR |
| Substrate Smiles | *[H] |
| Substrate Structure |
| Substrate Name | FMNH2 |
| Substrate Chemical Formula | C17H21N4O9P-2 |
| Substrate PubChem CID | 44229161 |
| Substrate Smiles | CC1=CC2=C(C=C1C)N(C3=C(N2)C(=O)NC(=O)N3)C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
Product Information:
| Product Name | An Alcohol |
| Product Chemical Formula | HOR |
| Product PubChem SID | 8145368 |
| Product Smiles | O[*] |
| Product Structure |
| Product Name | FMN |
| Product Chemical Formula | C17H18N4O9P-3 |
| Product PubChem CID | 44229199 |
| Product Smiles | CC1=CC2=C(C=C1C)N(C3=NC(=NC(=O)C3=N2)[O-])C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
| Product Name | H+ |
| Product Chemical Formula | H+ |
| Product PubChem CID | 1038 |
| Product CAS Number | 12408-02-5 |
| Product Smiles | [H+] |
| Product Structure |
References:
| Title: | Structural and spectroscopic analysis of the F393H mutant of flavocytochrome P450 BM3. |
| PMID: | 11695889 |
| Journal: | Biochemistry |
| Year: | 2001/11/13 |
| Title: | Pivotal role of water in the mechanism of P450BM-3. |
| PMID: | 11695892 |
| Journal: | Biochemistry |
| Year: | 2001/11/13 |
| Title: | Oxygen activation and electron transfer in flavocytochrome P450 BM3. |
| PMID: | 14653735 |
| Journal: | Journal of the American Chemical Society |
| Year: | 2003/12/10 |
| Title: | The role of Thr268 and Phe393 in cytochrome P450 BM3. |
| PMID: | 16403573 |
| Journal: | Journal of inorganic biochemistry |
| Year: | 2006/5/1 |
| Title: | Selective hydroxylation of highly branched fatty acids and their derivatives by CYP102A1 from Bacillus megaterium. |
| PMID: | 16566047 |
| Journal: | Chembiochem : a European journal of chemical biology |
| Year: | 2006/5/1 |
| Title: | Structural and spectroscopic characterization of P450 BM3 mutants with unprecedented P450 heme iron ligand sets. New heme ligation states influence conformational equilibria in P450 BM3. |
| PMID: | 17077084 |
| Journal: | The Journal of biological chemistry |
| Year: | 2007/1/5 |
| Title: | Fatty acid monooxygenation by P450BM-3: product identification and proposed mechanisms for the sequential hydroxylation reactions. |
| PMID: | 1727637 |
| Journal: | Archives of biochemistry and biophysics |
| Year: | 1992/1/1 |
| Title: | Filling a hole in cytochrome P450 BM3 improves substrate binding and catalytic efficiency. |
| PMID: | 17868686 |
| Journal: | Journal of molecular biol |
| Year: | 2007/10/26 |
| Title: | Interactions of substrates at the surface of P450s can greatly enhance substrate potency. |
| PMID: | 18004886 |
| Journal: | |
| Year: | 2007/12/11 |
| Title: | Bacillus megaterium CYP102A1 oxidation of acyl homoserine lactones and acyl homoserines. |
| PMID: | 18020460 |
| Journal: | |
| Year: | 2007/12/18 |
| Title: | Crystal structure of inhibitor-bound P450BM-3 reveals open conformation of substrate access channel. |
| PMID: | 18298086 |
| Journal: | |
| Year: | 2008/3/25 |
| Title: | Evolutionary history of a specialized p450 propane monooxygenase. |
| PMID: | 18619466 |
| Journal: | |
| Year: | 2008/11/28 |
| Title: | Novel haem co-ordination variants of flavocytochrome P450BM3. |
| PMID: | 18721129 |
| Journal: | |
| Year: | 2009/1/1 |
| Title: | A highly active single-mutation variant of P450BM3 (CYP102A1). |
| PMID: | 19492389 |
| Journal: | |
| Year: | 2009/7/6 |
| Title: | Glutamate-haem ester bond formation is disfavoured in flavocytochrome P450 BM3: characterization of glutamate substitution mutants at the haem site of P450 BM3. |
| PMID: | 20180779 |
| Journal: | |
| Year: | 2010/4/14 |
| Title: | Structural basis for the properties of two single-site proline mutants of CYP102A1 (P450BM3). |
| PMID: | 21110374 |
| Journal: | |
| Year: | 2010/12/10 |
| Title: | A single active-site mutation of P450BM-3 dramatically enhances substrate binding and rate of product formation. |
| PMID: | 21875028 |
| Journal: | |
| Year: | 2011/10/4 |
| Title: | Cloning of the gene encoding a catalytically self-sufficient cytochrome P-450 fatty acid monooxygenase induced by barbiturates in Bacillus megaterium and its functional expression and regulation in heterologous (Escherichia coli) and homologous (Bacillus megaterium) hosts. |
| PMID: | 3106359 |
| Journal: | |
| Year: | 1987/5/15 |
| Title: | The role of Thr268 in oxygen activation of cytochrome P450BM-3. |
| PMID: | 7578081 |
| Journal: | |
| Year: | 1995/11/14 |