Detail Information
P450 Protein:
| P450 Symbol | CYP102A1 |
| Protein Name | Bifunctional cytochrome P450/NADPH--P450 reductase |
| Uniprot ID | P14779 |
| EC Number | 1.14.14.1; 1.6.2.4 |
| Gene ID | 93643681 |
| Species | Bacillus megaterium (strain ATCC 14581 / DSM 32 / JCM 2506 / NBRC 15308 / NCIMB 9376 / NCTC 10342 / NRRL B-14308 / VKM B-512) |
| Txid | 1348623 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | Cytoplasm |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C34H30FeN4O4- + C21H26N7O17P3-4 → C34H30FeN4O4-2 + C21H25N7O17P3-3 + H+ |
| Reaction Type | Reduction |
| Chemical Bond | Heme |
| RheaID | 24040 |
+
CYP102A1
+
+
Substrate Information:
| Substrate Name | Fe(III)-heme b |
| Substrate Chemical Formula | C34H30FeN4O4- |
| Substrate Smiles | CC1=C(CCC([O-])=O)C2=[N+]3C1=Cc1c(C)c(C=C)c4C=C5C(C)=C(C=C)C6=[N+]5[Fe-]3(n14)n1c(=C6)c(C)c(CCC([O-])=O)c1=C2 |
| Substrate Structure |
| Substrate Name | NADPH(4-) |
| Substrate Chemical Formula | C21H26N7O17P3-4 |
| Substrate PubChem CID | 15983949 |
| Substrate Smiles | C1C=CN(C=C1C(=O)N)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)([O-])OP(=O)([O-])OC[C@@H]3[C@H]([C@H]([C@@H](O3)N4C=NC5=C(N=CN=C54)N)OP(=O)([O-])[O-])O)O)O |
| Substrate Structure |
Product Information:
| Product Name | heme b |
| Product Chemical Formula | C34H30FeN4O4-2 |
| Product Smiles | CC1=C(CCC([O-])=O)C2=[N+]3C1=Cc1c(C)c(C=C)c4C=C5C(C)=C(C=C)C6=[N+]5[Fe--]3(n14)n1c(=C6)c(C)c(CCC([O-])=O)c1=C2 |
| Product Structure |
| Product Name | NADP+ |
| Product Chemical Formula | C21H25N7O17P3-3 |
| Product PubChem CID | 162422398 |
| Product Smiles | C1=CC(=C[N+](=C1)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)([O-])OP(=O)([O-])OC[C@@H]3[C@H]([C@H]([C@@H](O3)N4C=NC5=C(N=CN=C54)N)O)OP(=O)([O-])[O-])O)O)C(=O)N |
| Product Structure |
| Product Name | H+ |
| Product Chemical Formula | H+ |
| Product PubChem CID | 1038 |
| Product CAS Number | 12408-02-5 |
| Product Smiles | [H+] |
| Product Structure |
References:
| Title: | Structural and spectroscopic analysis of the F393H mutant of flavocytochrome P450 BM3. |
| PMID: | 11695889 |
| Journal: | Biochemistry |
| Year: | 2001/11/13 |
| Title: | Pivotal role of water in the mechanism of P450BM-3. |
| PMID: | 11695892 |
| Journal: | Biochemistry |
| Year: | 2001/11/13 |
| Title: | Oxygen activation and electron transfer in flavocytochrome P450 BM3. |
| PMID: | 14653735 |
| Journal: | Journal of the American Chemical Society |
| Year: | 2003/12/10 |
| Title: | The role of Thr268 and Phe393 in cytochrome P450 BM3. |
| PMID: | 16403573 |
| Journal: | Journal of inorganic biochemistry |
| Year: | 2006/5/1 |
| Title: | Selective hydroxylation of highly branched fatty acids and their derivatives by CYP102A1 from Bacillus megaterium. |
| PMID: | 16566047 |
| Journal: | Chembiochem : a European journal of chemical biology |
| Year: | 2006/5/1 |
| Title: | Structural and spectroscopic characterization of P450 BM3 mutants with unprecedented P450 heme iron ligand sets. New heme ligation states influence conformational equilibria in P450 BM3. |
| PMID: | 17077084 |
| Journal: | The Journal of biological chemistry |
| Year: | 2007/1/5 |
| Title: | Fatty acid monooxygenation by P450BM-3: product identification and proposed mechanisms for the sequential hydroxylation reactions. |
| PMID: | 1727637 |
| Journal: | Archives of biochemistry and biophysics |
| Year: | 1992/1/1 |
| Title: | Filling a hole in cytochrome P450 BM3 improves substrate binding and catalytic efficiency. |
| PMID: | 17868686 |
| Journal: | Journal of molecular biol |
| Year: | 2007/10/26 |
| Title: | Interactions of substrates at the surface of P450s can greatly enhance substrate potency. |
| PMID: | 18004886 |
| Journal: | |
| Year: | 2007/12/11 |
| Title: | Bacillus megaterium CYP102A1 oxidation of acyl homoserine lactones and acyl homoserines. |
| PMID: | 18020460 |
| Journal: | |
| Year: | 2007/12/18 |
| Title: | Crystal structure of inhibitor-bound P450BM-3 reveals open conformation of substrate access channel. |
| PMID: | 18298086 |
| Journal: | |
| Year: | 2008/3/25 |
| Title: | Evolutionary history of a specialized p450 propane monooxygenase. |
| PMID: | 18619466 |
| Journal: | |
| Year: | 2008/11/28 |
| Title: | Novel haem co-ordination variants of flavocytochrome P450BM3. |
| PMID: | 18721129 |
| Journal: | |
| Year: | 2009/1/1 |
| Title: | A highly active single-mutation variant of P450BM3 (CYP102A1). |
| PMID: | 19492389 |
| Journal: | |
| Year: | 2009/7/6 |
| Title: | Glutamate-haem ester bond formation is disfavoured in flavocytochrome P450 BM3: characterization of glutamate substitution mutants at the haem site of P450 BM3. |
| PMID: | 20180779 |
| Journal: | |
| Year: | 2010/4/14 |
| Title: | Structural basis for the properties of two single-site proline mutants of CYP102A1 (P450BM3). |
| PMID: | 21110374 |
| Journal: | |
| Year: | 2010/12/10 |
| Title: | A single active-site mutation of P450BM-3 dramatically enhances substrate binding and rate of product formation. |
| PMID: | 21875028 |
| Journal: | |
| Year: | 2011/10/4 |
| Title: | Cloning of the gene encoding a catalytically self-sufficient cytochrome P-450 fatty acid monooxygenase induced by barbiturates in Bacillus megaterium and its functional expression and regulation in heterologous (Escherichia coli) and homologous (Bacillus megaterium) hosts. |
| PMID: | 3106359 |
| Journal: | |
| Year: | 1987/5/15 |
| Title: | The role of Thr268 in oxygen activation of cytochrome P450BM-3. |
| PMID: | 7578081 |
| Journal: | |
| Year: | 1995/11/14 |