P450 Protein:
| P450 Symbol | CYP27A1 |
| Protein Name | Sterol 26-hydroxylase, mitochondrial |
| Uniprot ID | P17177 |
| EC Number | 1.14.15.15 |
| Gene ID | 100348736 |
| Species | Oryctolagus cuniculus (Rabbit) |
| Txid | 9986 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | / |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C27H48O4 + Fe2S2 + O2 + H+ → C27H46O4 + Fe2S2 + H2O |
| Reaction Type | Oxidation |
| Chemical Bond | CH2-OH |
| RheaID | 40231 |
CYP27A1
Substrate Information:
| Substrate Name | (25R)-5Beta-Cholestane-3Alpha,7Alpha,12Alpha,26-Tetrol |
| Substrate Chemical Formula | C27H48O4 |
| Substrate PubChem CID | 24771793 |
| Substrate Smiles | C[C@H](CCC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C)CO |
| Substrate Structure |
| Substrate Name | [2Fe-2S]1+ |
| Substrate Chemical Formula | Fe2S2 |
| Substrate Smiles | S1[Fe]S[Fe+]1 |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
| Substrate Name | H+ |
| Substrate Chemical Formula | H+ |
| Substrate PubChem CID | 1038 |
| Substrate CAS Number | 12408-02-5 |
| Substrate Smiles | [H+] |
| Substrate Structure |
Product Information:
| Product Name | (25R)-3Alpha,7Alpha,12Alpha-Trihydroxy-5Beta-Cholestan-26-Al |
| Product Chemical Formula | C27H46O4 |
| Product PubChem CID | 24771792 |
| Product Smiles | C[C@H](CCC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1([C@H](C[C@H]3[C@H]2[C@@H](C[C@H]4[C@@]3(CC[C@H](C4)O)C)O)O)C)C=O |
| Product Structure |
| Product Name | [2Fe-2S]2+ |
| Product Chemical Formula | Fe2S2 |
| Product Smiles | S1[Fe+]S[Fe+]1 |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Cloning, structure, and expression of the mitochondrial cytochrome P-450 sterol 26-hydroxylase, a bile acid biosynthetic enzyme. |
| PMID: | 2722778 |
| Journal: | The Journal of biological chemistry |
| Year: | 1989/5/15 |