Detail Information
P450 Protein:
| P450 Symbol | CYP105A1 |
| Protein Name | Vitamin D3 dihydroxylase |
| Uniprot ID | P18326 |
| EC Number | 1.14.15.22 |
| Species | Streptomyces griseolus |
| Txid | 1909 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | Cytoplasm |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C27H44O2 + Fe2S2 + O2 + H+ → C27H44O3 + Fe2S2 + H2O |
| Reaction Type | Oxidation |
| Chemical Bond | CH2 |
| RheaID | 50700 |
+
+
+
CYP105A1
+
+
Substrate Information:
| Substrate Name | Calcidiol |
| Substrate Chemical Formula | C27H44O2 |
| Substrate PubChem CID | 5283731 |
| Substrate Smiles | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@H]2[C@@]1(CCC/C2=CC=C/3C[C@H](CCC3=C)O)C |
| Substrate Structure |
| Substrate Name | [2Fe-2S]1+ |
| Substrate Chemical Formula | Fe2S2 |
| Substrate Smiles | S1[Fe]S[Fe+]1 |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
| Substrate Name | H+ |
| Substrate Chemical Formula | H+ |
| Substrate PubChem CID | 1038 |
| Substrate CAS Number | 12408-02-5 |
| Substrate Smiles | [H+] |
| Substrate Structure |
Product Information:
| Product Name | Calcitriol |
| Product Chemical Formula | C27H44O3 |
| Product PubChem CID | 5280453 |
| Product Smiles | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@H]2[C@@]1(CCC/C2=CC=C/3C[C@H](C[C@@H](C3=C)O)O)C |
| Product Structure |
| Product Name | [2Fe-2S]2+ |
| Product Chemical Formula | Fe2S2 |
| Product Smiles | S1[Fe+]S[Fe+]1 |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Conversion of vitamin D3 to 1alpha,25-dihydroxyvitamin D3 by Streptomyces griseolus cytochrome P450SU-1. |
| PMID: | 15207715 |
| Journal: | Biochemical and biophysical research communications |
| Year: | 2004/7/16 |
| Title: | Crystal structure of CYP105A1 (P450SU-1) in complex with 1alpha,25-dihydroxyvitamin D3. |
| PMID: | 18314962 |
| Journal: | Biochemistry |
| Year: | 2008/4/1 |
| Title: | Structure-based design of a highly active vitamin D hydroxylase from Streptomyces griseolus CYP105A1. |
| PMID: | 18937506 |
| Journal: | Biochemistry |
| Year: | 2008/11/18 |