P450 Protein:
| P450 Symbol | CYP11B2 |
| Protein Name | Cytochrome P450 11B2, mitochondrial |
| Uniprot ID | P19099 |
| EC Number | 1.14.15.4; 1.14.15.5 |
| Gene ID | 1585 |
| Species | Homo sapiens (Human) |
| Txid | 9606 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C21H30O5 + Fe2S2 + O2 + H+ → C21H30O6 + Fe2S2 + H2O |
| Reaction Type | Oxidation |
| Chemical Bond | |
| RheaID | 76019 |
CYP11B2
Substrate Information:
| Substrate Name | Cortisol |
| Substrate Chemical Formula | C21H30O5 |
| Substrate PubChem CID | 5754 |
| Substrate Smiles | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@@]4(C(=O)CO)O)C)O |
| Substrate Structure |
| Substrate Name | [2Fe-2S]1+ |
| Substrate Chemical Formula | Fe2S2 |
| Substrate Smiles | S1[Fe]S[Fe+]1 |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
| Substrate Name | H+ |
| Substrate Chemical Formula | H+ |
| Substrate PubChem CID | 1038 |
| Substrate CAS Number | 12408-02-5 |
| Substrate Smiles | [H+] |
| Substrate Structure |
Product Information:
| Product Name | 18-Hydroxycortisol |
| Product Chemical Formula | C21H30O6 |
| Product PubChem CID | 44263343 |
| Product Smiles | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@]4(C(=O)CO)O)CO)O |
| Product Structure |
| Product Name | [2Fe-2S]2+ |
| Product Chemical Formula | Fe2S2 |
| Product Smiles | S1[Fe+]S[Fe+]1 |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Studies on the origin of circulating 18-hydroxycortisol and 18-oxocortisol in normal human subjects. |
| PMID: | 15356073 |
| Journal: | J Clin Endocrinol Metab |
| Year: | 2005/9 |
| Title: | Recombinant CYP11B genes encode enzymes that can catalyze conversion of 11-deoxycortisol to cortisol, 18-hydroxycortisol, and 18-oxocortisol. |
| PMID: | 9814482 |
| Journal: | |
| Year: | 1998/11/1 |