Detail Information
P450 Protein:
| P450 Symbol | CYP55A1 |
| Protein Name | NADP nitrous oxide-forming nitric oxide reductase |
| Uniprot ID | P23295 |
| EC Number | 1.7.1.14 |
| Species | Fusarium oxysporum (Fusarium vascular wilt) |
| Txid | 5507 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | / |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | N2O + C21H26N7O14P2- + H2O → NO + C21H27N7O14P2-2 + H+ |
| Reaction Type | Reduction |
| Chemical Bond | -N(-)-N(+)- |
| RheaID | 29607 |
+
+
CYP55A1
+
+
Substrate Information:
| Substrate Name | Nitrous Oxide |
| Substrate Chemical Formula | N2O |
| Substrate PubChem CID | 948 |
| Substrate Smiles | [N-]=[N+]=O |
| Substrate Structure |
| Substrate Name | NAD+ |
| Substrate Chemical Formula | C21H26N7O14P2- |
| Substrate PubChem CID | 15938971 |
| Substrate Smiles | C1=CC(=C[N+](=C1)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)([O-])OP(=O)([O-])OC[C@@H]3[C@H]([C@H]([C@@H](O3)N4C=NC5=C(N=CN=C54)N)O)O)O)O)C(=O)N |
| Substrate Structure |
| Substrate Name | H2O |
| Substrate Chemical Formula | H2O |
| Substrate PubChem CID | 962 |
| Substrate CAS Number | 7732-18-5 |
| Substrate Smiles | O |
| Substrate Structure |
Product Information:
| Product Name | Nitric Oxide |
| Product Chemical Formula | NO |
| Product PubChem CID | 145068 |
| Product Smiles | [N]=O |
| Product Structure |
| Product Name | NADH |
| Product Chemical Formula | C21H27N7O14P2-2 |
| Product PubChem CID | 21604869 |
| Product Smiles | C1C=CN(C=C1C(=O)N)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)([O-])OP(=O)([O-])OC[C@@H]3[C@H]([C@H]([C@@H](O3)N4C=NC5=C(N=CN=C54)N)O)O)O)O |
| Product Structure |
| Product Name | H+ |
| Product Chemical Formula | H+ |
| Product PubChem CID | 1038 |
| Product CAS Number | 12408-02-5 |
| Product Smiles | [H+] |
| Product Structure |
References:
| Title: | Proton delivery in NO reduction by fungal nitric-oxide reductase. Cryogenic crystallography, spectroscopy, and kinetics of ferric-NO complexes of wild-type and mutant enzymes. |
| PMID: | 10671516 |
| Journal: | The Journal of biological chemistry |
| Year: | 2000/2/18 |
| Title: | Structural evidence for direct hydride transfer from NADH to cytochrome P450nor. |
| PMID: | 15313618 |
| Journal: | Journal of molecular biology |
| Year: | 2004/9/3 |
| Title: | Denitrification by the fungus Fusarium oxysporum and involvement of cytochrome P-450 in the respiratory nitrite reduction. |
| PMID: | 2040619 |
| Journal: | The Journal of biological chemistry |
| Year: | 1991/6/15 |
| Title: | Spectroscopic and kinetic studies on reaction of cytochrome P450nor with nitric oxide. Implication for its nitric oxide reduction mechanism. |
| PMID: | 7829493 |
| Journal: | The Journal of biological chemistry |
| Year: | 1995/1/27 |