P450 Protein:
| P450 Symbol | CYP2J2 |
| Protein Name | Cytochrome P450 2J2 |
| Uniprot ID | P51589 |
| EC Number | 1.14.14.-; 1.14.14.73; 1.14.14.74; 5.4.4.7 |
| Gene ID | 1573 |
| Species | Homo sapiens (Human) |
| Txid | 9606 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | Membrane; Single-pass membrane protein |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C20H31O4- → C20H31O4- |
| Reaction Type | Oxidation |
| Chemical Bond | O-O;CH-CH |
| RheaID | 37959 |
CYP2J2
Substrate Information:
| Substrate Name | (15S)-Hydroperoxy-(5Z,8Z,11Z,13E)-Eicosatetraenoate |
| Substrate Chemical Formula | C20H31O4- |
| Substrate PubChem CID | 21158477 |
| Substrate Smiles | CCCCC[C@@H](/C=C/C=CC/C=CC/C=CCCCC(=O)[O-])OO |
| Substrate Structure |
Product Information:
| Product Name | (13R)-Hydroxy-(14S,15S)-Epoxy-(5Z,8Z,11Z)-Eicosatrienoate |
| Product Chemical Formula | C20H31O4- |
| Product PubChem CID | 71728436 |
| Product Smiles | CCCCC[C@H]1[C@@H](O1)[C@@H](/C=CC/C=CC/C=CCCCC(=O)[O-])O |
| Product Structure |
References:
| Title: | Identification of 13-hydroxy-14,15-epoxyeicosatrienoic acid as an acid-stable endothelium-derived hyperpolarizing factor in rabbit arteries. |
| PMID: | 19737933 |
| Journal: | The Journal of biological chemistry |
| Year: | 2009/11/6 |