Detail Information
P450 Protein:
| P450 Symbol | CYP24A1 |
| Protein Name | 1,25-dihydroxyvitamin D(3) 24-hydroxylase, mitochondrial |
| Uniprot ID | Q07973 |
| EC Number | 1.14.15.16 |
| Gene ID | 1591 |
| Species | Homo sapiens (Human) |
| Txid | 9606 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | Membrane; Single-pass type II membrane protein |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C23H36O3 + Fe2S2 + O2 + H+ → C23H34O3 + Fe2S2 + H2O |
| Reaction Type | Oxidation |
| Chemical Bond | CH2-OH |
| RheaID | 24984 |
+
+
+
CYP24A1
+
+
Substrate Information:
| Substrate Name | (1S)-1,23-Dihydroxy-24,25,26,27-Tetranorcalciol |
| Substrate Chemical Formula | C23H36O3 |
| Substrate PubChem CID | 9547280 |
| Substrate Smiles | C[C@H](CCO)[C@H]1CC[C@@H]2[C@@]1(CCC/C2=CC=C/3C[C@H](C[C@@H](C3=C)O)O)C |
| Substrate Structure |
| Substrate Name | [2Fe-2S]1+ |
| Substrate Chemical Formula | Fe2S2 |
| Substrate Smiles | S1[Fe]S[Fe+]1 |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
| Substrate Name | H+ |
| Substrate Chemical Formula | H+ |
| Substrate PubChem CID | 1038 |
| Substrate CAS Number | 12408-02-5 |
| Substrate Smiles | [H+] |
| Substrate Structure |
Product Information:
| Product Name | (1S)-1-Hydroxy-23-Oxo-24,25,26,27-Tetranorcalciol |
| Product Chemical Formula | C23H34O3 |
| Product PubChem CID | 17756746 |
| Product Smiles | C[C@H](CC=O)[C@H]1CC[C@@H]2[C@@]1(CCC/C2=CC=C/3C[C@H](C[C@@H](C3=C)O)O)C |
| Product Structure |
| Product Name | [2Fe-2S]2+ |
| Product Chemical Formula | Fe2S2 |
| Product Smiles | S1[Fe+]S[Fe+]1 |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Structure-function analysis of vitamin D 24-hydroxylase (CYP24A1) by site-directed mutagenesis: amino acid residues responsible for species-based difference of CYP24A1 between humans and rats. |
| PMID: | 16617161 |
| Journal: | Molecular pharmacology |
| Year: | 2006/7/1 |
| Title: | Mutations in CYP24A1 and idiopathic infantile hypercalcemia. |
| PMID: | 21675912 |
| Journal: | The New England journal of medicine |
| Year: | 2011/8/4 |
| Title: | Kinetic analysis of human CYP24A1 metabolism of vitamin D via the C24-oxidation pathway. |
| PMID: | 24893882 |
| Journal: | The FEBS journal |
| Year: | 2014/7/1 |