Detail Information
P450 Protein:
| P450 Symbol | PTGIS |
| Protein Name | Prostacyclin synthase |
| Uniprot ID | Q29626 |
| EC Number | 4.2.1.152; 5.3.99.4 |
| Gene ID | 282021 |
| Species | Bos taurus (Bovine) |
| Txid | 9913 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | Endoplasmic reticulum membrane; Single-pass membrane protein |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C20H32O5 → C20H32O5 |
| Reaction Type | Reduction |
| Chemical Bond | O-O |
| RheaID | 23580 |
PTGIS
Substrate Information:
| Substrate Name | Prostaglandin H2 |
| Substrate Chemical Formula | C20H32O5 |
| Substrate PubChem CID | 445049 |
| Substrate Smiles | CCCCC[C@@H](/C=C/[C@H]1[C@H]2C[C@@H]([C@@H]1C/C=CCCCC(=O)O)OO2)O |
| Substrate Structure |
Product Information:
| Product Name | Prostaglandin I2 |
| Product Chemical Formula | C20H32O5 |
| Product PubChem CID | 5282411 |
| Product Smiles | CCCCC[C@@H](/C=C/[C@H]1[C@@H](C[C@H]2[C@@H]1C/C(=C/CCCC(=O)O)/O2)O)O |
| Product Structure |
References:
| Title: | Isolation and molecular cloning of prostacyclin synthase from bovine endothelial cells. |
| PMID: | 8051072 |
| Journal: | The Journal of biological chemistry |
| Year: | 1994/8/5 |
| Title: | Bovine prostacyclin synthase: purification and isolation of partial cDNA. |
| PMID: | 8280118 |
| Journal: | Biochemical and biophysical research communications |
| Year: | 1993/12/30 |