P450 Protein:
| P450 Symbol | CYP5A1 |
| Protein Name | Thromboxane-A synthase |
| Uniprot ID | Q2PG45 |
| EC Number | 4.2.1.152; 5.3.99.5 |
| Gene ID | 102128548 |
| Species | Macaca fascicularis (Crab-eating macaque) (Cynomolgus monkey) |
| Txid | 9541 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | Endoplasmic reticulum membrane; Multi-pass membrane protein |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C20H32O5 → C20H32O5 |
| Reaction Type | Reduction |
| Chemical Bond | O-O |
| RheaID | 17137 |
CYP5A1
Substrate Information:
| Substrate Name | Prostaglandin H2 |
| Substrate Chemical Formula | C20H32O5 |
| Substrate PubChem CID | 445049 |
| Substrate Smiles | CCCCC[C@@H](/C=C/[C@H]1[C@H]2C[C@@H]([C@@H]1C/C=CCCCC(=O)O)OO2)O |
| Substrate Structure |
Product Information:
| Product Name | Thromboxane A2 |
| Product Chemical Formula | C20H32O5 |
| Product PubChem CID | 5280497 |
| Product Smiles | CCCCC[C@@H](/C=C/[C@@H]1[C@H]([C@@H]2C[C@@H](O2)O1)C/C=CCCCC(=O)O)O |
| Product Structure |
References:
| Title: | Identification of thromboxane synthase amino acid residues involved in heme-propionate binding. |
| PMID: | 11097184 |
| Journal: | Archives of biochemistry and biophysics |
| Year: | 2000/11/1 |
| Title: | Substrate binding is the rate-limiting step in thromboxane synthase catalysis. |
| PMID: | 11297515 |
| Journal: | The Journal of biological chemistry |
| Year: | 2001/5/4 |
| Title: | Functional analysis of human thromboxane synthase polymorphic variants. |
| PMID: | 22735388 |
| Journal: | Pharmacogenetics and genomics |
| Year: | 2012/9/1 |
| Title: | Thromboxane A synthase-independent production of 12-hydroxyheptadecatrienoic acid, a BLT2 ligand. |
| PMID: | 24009185 |
| Journal: | Journal of lipid research |
| Year: | 2013/11/1 |
| Title: | Expression of human thromboxane synthase using a baculovirus system. |
| PMID: | 8436233 |
| Journal: | FEBS letters |
| Year: | 1993/2/22 |
| Title: | Expression, purification, and spectroscopic characterization of human thromboxane synthase. |
| PMID: | 9873013 |
| Journal: | The Journal of biological chemistry |
| Year: | 1999/1/8 |