P450 Protein:
| P450 Symbol | cyp158a2 |
| Protein Name | Biflaviolin synthase CYP158A2 |
| Uniprot ID | Q9FCA6 |
| EC Number | 1.14.19.69 |
| Gene ID | 1096630 |
| Species | Streptomyces coelicolor (strain ATCC BAA-471 / A3(2) / M145) |
| Txid | 100226 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | / |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C10H6O5 + Fe2S2 + O2 + H+ → C20H10O10 + Fe2S2 + H2O |
| Reaction Type | Combination |
| Chemical Bond | CH |
| RheaID | 26035 |
cyp158a2
Substrate Information:
| Substrate Name | Flaviolin |
| Substrate Chemical Formula | C10H6O5 |
| Substrate PubChem CID | 160478 |
| Substrate Smiles | C1=C(C=C(C2=C1C(=O)C(=O)C=C2O)O)O |
| Substrate Structure |
| Substrate Name | [2Fe-2S]1+ |
| Substrate Chemical Formula | Fe2S2 |
| Substrate Smiles | S1[Fe]S[Fe+]1 |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
| Substrate Name | H+ |
| Substrate Chemical Formula | H+ |
| Substrate PubChem CID | 1038 |
| Substrate CAS Number | 12408-02-5 |
| Substrate Smiles | [H+] |
| Substrate Structure |
Product Information:
| Product Name | 3,8′-Biflaviolin |
| Product Chemical Formula | C20H10O10 |
| Product PubChem CID | 25164057 |
| Product Smiles | C1=C(C=C(C2=C1C(=O)C(=O)C(=C2O)C3=C(C=C(C4=C3C(=O)C(=O)C=C4O)O)O)O)O |
| Product Structure |
| Product Name | [2Fe-2S]2+ |
| Product Chemical Formula | Fe2S2 |
| Product Smiles | S1[Fe+]S[Fe+]1 |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Binding of two flaviolin substrate molecules, oxidative coupling, and crystal structure of Streptomyces coelicolor A3(2) cytochrome P450 158A2. |
| PMID: | 15659395 |
| Journal: | The Journal of biological chemistry |
| Year: | 2005/3/25 |
| Title: | Role of active site water molecules and substrate hydroxyl groups in oxygen activation by cytochrome P450 158A2: a new mechanism of proton transfer. |
| PMID: | 16239228 |
| Journal: | The Journal of biological chemistry |
| Year: | 2005/12/23 |
| Title: | The role of Ile87 of CYP158A2 in oxidative coupling reaction. |
| PMID: | 22203090 |
| Journal: | Archives of biochemistry and biophysics |
| Year: | 2012/2/15 |