P450 Protein:
| P450 Symbol | CYP170A1 |
| Protein Name | Bifunctional albaflavenone monooxygenase/terpene synthase |
| Uniprot ID | Q9K498 |
| EC Number | 1.14.15.39; 4.2.3.47 |
| Gene ID | 1100664 |
| Species | Streptomyces coelicolor (strain ATCC BAA-471 / A3(2) / M145) |
| Txid | 100226 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | / |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C15H24 + Fe2S2 + O2 + H+ → C15H24O + Fe2S2 + H2O |
| Reaction Type | Oxidation |
| Chemical Bond | CH2 |
| RheaID | 25976 |
CYP170A1
Substrate Information:
| Substrate Name | Epi-Isozizaene |
| Substrate Chemical Formula | C15H24 |
| Substrate PubChem CID | 23724686 |
| Substrate Smiles | C[C@H]1CCC2=C(C([C@H]3CC[C@@]12C3)(C)C)C |
| Substrate Structure |
| Substrate Name | [2Fe-2S]1+ |
| Substrate Chemical Formula | Fe2S2 |
| Substrate Smiles | S1[Fe]S[Fe+]1 |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
| Substrate Name | H+ |
| Substrate Chemical Formula | H+ |
| Substrate PubChem CID | 1038 |
| Substrate CAS Number | 12408-02-5 |
| Substrate Smiles | [H+] |
| Substrate Structure |
Product Information:
| Product Name | (5S)-albaflavenol |
| Product Chemical Formula | C15H24O |
| Product PubChem CID | 25137910 |
| Product Smiles | C[C@H]1C[C@@H](C2=C(C([C@H]3CC[C@@]12C3)(C)C)C)O |
| Product Structure |
| Product Name | [2Fe-2S]2+ |
| Product Chemical Formula | Fe2S2 |
| Product Smiles | S1[Fe+]S[Fe+]1 |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Biosynthesis of the sesquiterpene antibiotic albaflavenone in Streptomyces coelicolor A3(2). |
| PMID: | 18234666 |
| Journal: | The Journal of biological chemistry |
| Year: | 2008/3/28 |