Detail Information
P450 Protein:
| P450 Symbol | AurH |
| Protein Name | Putative cytochrome P450 |
| Uniprot ID | Q70KH6 |
| EC Number | 1.14.15.37 |
| Gene ID | 66737957 |
| Species | Streptomyces thioluteus |
| Txid | 66431 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C15H19IO3 + C15H22N6O5S → C16H21IO3 |
| Reaction Type | Oxidation |
| Chemical Bond | C=O |
| Solvents | Dimethyl sulfoxide, Water |
+
AurH
Substrate Information:
| Substrate Name | 4-hydroxy-6-[(3E,5E)-6-iodo-3,5-dimethylhexa-3,5-dienyl]-3,5-dimethylpyran-2-one |
| Substrate Chemical Formula | C15H19IO3 |
| Substrate PubChem CID | 134838055 |
| Substrate Smiles | CC1=C(OC(=O)C(=C1O)C)CC/C(=C/C(=C/I)/C)/C |
| Substrate Structure |
| Substrate Name | Ademetionine |
| Substrate Chemical Formula | C15H22N6O5S |
| Substrate PubChem CID | 34755 |
| Substrate CAS Number | 29908-03-0 |
| Substrate Smiles | C[S+](CC[C@@H](C(=O)[O-])N)C[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)O |
| Substrate Structure |
Product Information:
| Product Name | 2-[(3E,5E)-6-iodo-3,5-dimethylhexa-3,5-dienyl]-6-methoxy-3,5-dimethylpyran-4-one |
| Product Chemical Formula | C16H21IO3 |
| Product PubChem CID | 134857576 |
| Product CAS Number | 1135345-07-1 |
| Product Smiles | O=C1C(=C(OC(=C1C)CCC(=CC(=CI)C)C)OC)C |
| Product Structure |
References:
| Title: | Chemoenzymatic total synthesis of the antiproliferative polyketide (+)-(R)-aureothin. |
| PMID: | 18690656 |
| Journal: | ChemBioChem (2008) |
| Year: | 2008/9/1 |