P450 Protein:
| P450 Symbol | AurH |
| Protein Name | Putative cytochrome P450 |
| Uniprot ID | Q70KH6 |
| EC Number | 1.14.15.37 |
| Gene ID | 66737957 |
| Species | Streptomyces thioluteus |
| Txid | 66431 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C22H25NO5 + Fe2S2 + O2 + H+ → C22H23NO6 + Fe2S2 + H2O |
| Reaction Type | Oxidation |
| Chemical Bond | CH |
| RheaID | 58824 |
AurH
Substrate Information:
| Substrate Name | luteothin |
| Substrate Chemical Formula | C22H25NO5 |
| Substrate PubChem CID | 11246062 |
| Substrate Smiles | CC1=C(OC(=C(C1=O)C)OC)CC/C(=C/C(=C/C2=CC=C(C=C2)[N+](=O)[O-])/C)/C |
| Substrate Structure |
| Substrate Name | [2Fe-2S]1+ |
| Substrate Chemical Formula | Fe2S2 |
| Substrate Smiles | S1[Fe]S[Fe+]1 |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
| Substrate Name | H+ |
| Substrate Chemical Formula | H+ |
| Substrate PubChem CID | 1038 |
| Substrate CAS Number | 12408-02-5 |
| Substrate Smiles | [H+] |
| Substrate Structure |
Product Information:
| Product Name | aureothin |
| Product Chemical Formula | C22H23NO6 |
| Product PubChem CID | 6569946 |
| Product Smiles | CC1=C(OC(=C(C1=O)C)OC)C2CC(=CC(=CC3=CC=C(C=C3)[N+](=O)[O-])C)CO2 |
| Product Structure |
| Product Name | [2Fe-2S]2+ |
| Product Chemical Formula | Fe2S2 |
| Product Smiles | S1[Fe+]S[Fe+]1 |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Formation of the aureothin tetrahydrofuran ring by a bifunctional cytochrome p450 monooxygenase. |
| PMID: | 15612710 |
| Journal: | Journal of the American Chemical Society |
| Year: | 2004/12/3 |