P450 Protein:
| P450 Symbol | CYP19A1 |
| Protein Name | Aromatase |
| Uniprot ID | P11511 |
| EC Number | 1.14.14.1 |
| Gene ID | 1543 |
| Species | Homo sapiens |
| Txid | 9606 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C14H12N2 → C13H10N2 |
| Reaction Type | Substitution |
| Chemical Bond | |
| Solvents | Dimethyl sulfoxide, Water |
| Conditions | 1 - 2 min, pH 7.2 - 7.8, 30°C; 30°C |
| Transformations | 1. N-Dealkylation of Amines, Amides and Sulfoamides |
CYP19A1
Substrate Information:
| Substrate Name | N-Methyl-9-acridinamine |
| Substrate Chemical Formula | C14H12N2 |
| Substrate PubChem CID | 31503 |
| Substrate Smiles | CNC1=C2C=CC=CC2=NC3=CC=CC=C31 |
| Substrate Structure |
Product Information:
| Product Name | 9-Aminoacridine |
| Product Chemical Formula | C13H10N2 |
| Product PubChem CID | 7019 |
| Product CAS Number | 90-45-9 |
| Product Smiles | C1=CC=C2C(=C1)C(=C3C=CC=CC3=N2)N |
| Product Structure |
References:
| Title: | Assays employing novel 9-N-alkylacridine substrates for measuring P 450-mediated N-dealkylation, and drug screening applications |
| Patent ID: | US20070015235 |
| Journal: | |
| Year: | 2007/1/18 |