P450 Protein:
| P450 Symbol | CYP101A1 |
| Protein Name | Camphor 5-monooxygenase |
| Uniprot ID | P00183 |
| EC Number | 1.14.15.1 |
| Gene ID | 9617760 |
| Species | Pseudomonas putida |
| Txid | 303 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C11H16O → C11H16O2 |
| Reaction Type | Oxidation |
| Chemical Bond | C=C |
| Transformations | 1. Epoxidation of Alkenes |
CYP101A1
Substrate Information:
| Substrate Name | (1R,4S)-1,7,7-Trimethyl-5-methylenebicyclo[2.2.1]heptan-2-one |
| Substrate Chemical Formula | C11H16O |
| Substrate PubChem CID | 101237419 |
| Substrate Smiles | O=C1CC2C(=C)CC1(C)C2(C)C |
| Substrate Structure |
Product Information:
| Product Name | Spiro[bicyclo[2.2.1]heptane-2,2′-oxiran]-5-one, 4,7,7-trimethyl-, [1R-(1alpha,2alpha,4alpha)] |
| Product Chemical Formula | C11H16O2 |
| Product CAS Number | 154614-04-7 |
| Product Smiles | O=C1CC2C3(OC3)CC1(C)C2(C)C |
| Product Structure |
References:
| Title: | The syntheses of 1R- and 1S-5-methylenylcamphor and their epoxidation by cytochrome P-450-CAM |
| DOI: | https://doi.org/10.1016/0040-4020(93)80022-L |
| Journal: | Tetrahedron |
| Year: | 1905/6/15 |