P450 Protein:
| P450 Symbol | MGG_10859 |
| Protein Name | Bifunctional dioxygenase (DOX)-epoxy alcohol synthase (EAS) (10R-DOX-EAS) [Includes: Fatty acid alpha-dioxygenase (DOX) (EC 1.13.11.-) (EC 1.13.11.62); Epoxy alcohol synthase (EAS) (EC 1.-.-.-) (Cytochrome P450 monooxygenase) (CYP)] |
| Uniprot ID | G4N2X9 |
| EC Number | 1.-.-.-; 1.13.11.-; 1.13.11.62 |
| Gene ID | 2676375 |
| Species | Pyricularia oryzae (strain 70-15 / ATCC MYA-4617 / FGSC 8958) (Rice blast fungus) (Magnaporthe oryzae) |
| Txid | 242507 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C20H33O2- + O2 → C20H33O4- |
| Reaction Type | Cyclization |
| Chemical Bond | C=C |
| RheaID | 75667 |
MGG_10859
Substrate Information:
| Substrate Name | (11Z,14Z,17Z)-eicosatrienoate |
| Substrate Chemical Formula | C20H33O2- |
| Substrate PubChem CID | 40488835 |
| Substrate Smiles | CCC=CCC=CCC=CCCCCCCCCCC(=O)[O-] |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
Product Information:
| Product Name | 12-hydroperoxy-(10E,14Z,17Z)-eicosatrienoate |
| Product Chemical Formula | C20H33O4- |
| Product PubChem CID | 168007625 |
| Product Smiles | CCC=CCC=CCC(C=CCCCCCCCCC(=O)[O-])OO |
| Product Structure |
References:
| Title: | The genome sequence of the rice blast fungus Magnaporthe grisea. |
| PMID: | 15846337 |
| Journal: | Journal of lipid research |
| Year: | 2012/2/ |
| Title: | Genome-wide transcriptional profiling of appressorium development by the rice blast fungus Magnaporthe oryzae. |
| PMID: | 22346750 |
| Journal: | Nature |
| Year: | 2005/4/21 |
| Title: | Epoxy alcohol synthase of the rice blast fungus represents a novel subfamily of dioxygenase-cytochrome P450 fusion enzymes. |
| PMID: | 25121983 |
| Journal: | PLoS pathogens |
| Year: | 2014/10/ |