Detail Information
P450 Protein:
| P450 Symbol | ppoA |
| Protein Name | Psi-producing oxygenase A (Fatty acid oxygenase ppoA) [Includes: Linoleate 8R-lipoxygenase (EC 1.13.11.60); 9,12-octadecadienoate 8-hydroperoxide 8R-isomerase (EC 5.4.4.5)] |
| Uniprot ID | Q6RET3 |
| EC Number | 1.13.11.60; 5.4.4.5 |
| Species | Emericella nidulans (Aspergillus nidulans) |
| Txid | 162425 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C18H32O4 → C18H31O4- |
| Reaction Type | Elimination |
| Chemical Bond | |
| RheaID | 31579 |
ppoA
Substrate Information:
| Substrate Name | (8R,9Z,12Z)-8-hydroperoxyoctadeca-9,12-dienoate |
| Substrate Chemical Formula | C18H32O4 |
| Substrate PubChem CID | 6438758 |
| Substrate Smiles | CCCCCC=CCC=CC(CCCCCCC(=O)O)OO |
| Substrate Structure |
Product Information:
| Product Name | (5S,8R,9Z,12Z)-5,8-dihydroxyoctadeca-9,12-dienoate |
| Product Chemical Formula | C18H31O4- |
| Product PubChem CID | 25755601 |
| Product Smiles | CCCCCC=CCC=CC(CCC(CCCC(=O)[O-])O)O |
| Product Structure |
References:
| Title: | The lipid body protein, PpoA, coordinates sexual and asexual sporulation in Aspergillus nidulans. |
| PMID: | 14699095 |
| Journal: | The Journal of biological chemistry |
| Year: | 2009/5/1 |
| Title: | Identification of PpoA from Aspergillus nidulans as a fusion protein of a fatty acid heme dioxygenase/peroxidase and a cytochrome P450. |
| PMID: | 19286665 |
| Journal: | |
| Year: | 2004/3/19 |