Detail Information
P450 Protein:
| P450 Symbol | Cyp26b1 |
| Protein Name | Cytochrome P450 26B1 (EC 1.14.13.-) (Cytochrome P450 retinoic acid-inactivating 2) (Cytochrome P450RAI-2) |
| Uniprot ID | Q811W2 |
| EC Number | 1.14.13.- |
| Gene ID | 232174 |
| Species | Mus musculus (Mouse) |
| Txid | 10090 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C20H27O2- + C17H21N4O9P-2 + O2 → C20H28O3 + C17H18N4O9P-3 + H2O + H+ |
| Reaction Type | Oxidation |
| Chemical Bond | CH2 |
| RheaID | 51984 |
+
+
Cyp26b1
+
+
+
Substrate Information:
| Substrate Name | all-trans-retinoate |
| Substrate Chemical Formula | C20H27O2- |
| Substrate PubChem CID | 6419707 |
| Substrate Smiles | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC(=O)[O-])C)C |
| Substrate Structure |
| Substrate Name | FMNH2 |
| Substrate Chemical Formula | C17H21N4O9P-2 |
| Substrate PubChem CID | 44229161 |
| Substrate Smiles | CC1=CC2=C(C=C1C)N(C3=C(N2)C(=O)NC(=O)N3)C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
Product Information:
| Product Name | all-trans-4-hydroxyretinoate |
| Product Chemical Formula | C20H28O3 |
| Product PubChem CID | 6438629 |
| Product Smiles | CC1=C(C(CCC1O)(C)C)C=CC(=CC=CC(=CC(=O)O)C)C |
| Product Structure |
| Product Name | FMN |
| Product Chemical Formula | C17H18N4O9P-3 |
| Product PubChem CID | 44229199 |
| Product Smiles | CC1=CC2=C(C=C1C)N(C3=NC(=NC(=O)C3=N2)[O-])C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
| Product Name | H+ |
| Product Chemical Formula | H+ |
| Product PubChem CID | 1038 |
| Product CAS Number | 12408-02-5 |
| Product Smiles | [H+] |
| Product Structure |
References:
| Title: | Sexually dimorphic gene expression in the developing mouse gonad. |
| PMID: | 12617826 |
| Journal: | Proceedings of the National Academy of Sciences of the United States of America |
| Year: | 2002/12/ |
| Title: | The transcriptional landscape of the mammalian genome. |
| PMID: | 16141072 |
| Journal: | Science (New York, N.Y.) |
| Year: | 2005/7/29 |
| Title: | Lineage-specific biology revealed by a finished genome assembly of the mouse. |
| PMID: | 19468303 |
| Journal: | PloS one |
| Year: | 2006/2/21 |
| Title: | The status, quality, and expansion of the NIH full-length cDNA project: the Mammalian Gene Collection (MGC). |
| PMID: | 15489334 |
| Journal: | PLoS biology |
| Year: | 2009/5/5 |
| Title: | Metabolism and transactivation activity of 13,14-dihydroretinoic acid. |
| PMID: | 15911617 |
| Journal: | Gene expression patterns : GEP |
| Year: | 2005/9/2 |
| Title: | Retinoid signaling determines germ cell fate in mice. |
| PMID: | 16574820 |
| Journal: | American journal of human genetics |
| Year: | 2004/10/ |
| Title: | Retinoic acid regulates sex-specific timing of meiotic initiation in mice. |
| PMID: | 16461896 |
| Journal: | Genome research |
| Year: | 2006/4/28 |
| Title: | Cyp26b1 expression in murine Sertoli cells is required to maintain male germ cells in an undifferentiated state during embryogenesis. |
| PMID: | 19838304 |
| Journal: | The Journal of biological chemistry |
| Year: | 2011/11/11 |
| Title: | Craniosynostosis and multiple skeletal anomalies in humans and zebrafish result from a defect in the localized degradation of retinoic acid. |
| PMID: | 22019272 |
| Journal: | |
| Year: | 2009/10/19 |