P450 Protein:
| P450 Symbol | CYP85A1 |
| Protein Name | Cytochrome P450 85A1 (OsCYP85A1) (3-dehydroteasterone synthase) (EC 1.14.14.-) (C6-oxidase) (Protein DWARF) (OsDWARF) (Teasterone synthase) (EC 1.14.14.-) (Typhasterol synthase) (EC 1.14.14.-) |
| Uniprot ID | Q8GSQ1 |
| EC Number | 1.14.14.- |
| Species | Oryza sativa subsp. japonica (Rice) |
| Txid | 39947 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C28H50O3 + C17H21N4O9P-2 + O2 → C28H50O4 + C17H18N4O9P-3 + H2O + H+ |
| Reaction Type | Oxidation |
| Chemical Bond | CH2 |
| RheaID | 69959 |
CYP85A1
Substrate Information:
| Substrate Name | 6-deoxoteasterone |
| Substrate Chemical Formula | C28H50O3 |
| Substrate PubChem CID | 11144580 |
| Substrate Smiles | CC(C)C(C)C(C(C(C)C1CCC2C1(CCC3C2CCC4C3(CCC(C4)O)C)C)O)O |
| Substrate Structure |
| Substrate Name | FMNH2 |
| Substrate Chemical Formula | C17H21N4O9P-2 |
| Substrate PubChem CID | 44229161 |
| Substrate Smiles | CC1=CC2=C(C=C1C)N(C3=C(N2)C(=O)NC(=O)N3)C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
Product Information:
| Product Name | 6alpha-hydroxyteasterone |
| Product Chemical Formula | C28H50O4 |
| Product PubChem CID | 15928981 |
| Product Smiles | CC(C)C(C)C(C(C(C)C1CCC2C1(CCC3C2CC(C4C3(CCC(C4)O)C)O)C)O)O |
| Product Structure |
| Product Name | FMN |
| Product Chemical Formula | C17H18N4O9P-3 |
| Product PubChem CID | 44229199 |
| Product Smiles | CC1=CC2=C(C=C1C)N(C3=NC(=NC(=O)C3=N2)[O-])C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
| Product Name | H+ |
| Product Chemical Formula | H+ |
| Product PubChem CID | 1038 |
| Product CAS Number | 12408-02-5 |
| Product Smiles | [H+] |
| Product Structure |
References:
| Title: | Loss-of-function of a rice brassinosteroid biosynthetic enzyme, C-6 oxidase, prevents the organized arrangement and polar elongation of cells in the leaves and stem. |
| PMID: | 12445121 |
| Journal: | Biochemical and biophysical research communications |
| Year: | 2005/9/ |
| Title: | Sequence, annotation, and analysis of synteny between rice chromosome 3 and diverged grass species. |
| PMID: | 16109971 |
| Journal: | Plant physiology |
| Year: | 2013/2/6 |
| Title: | The map-based sequence of the rice genome. |
| PMID: | 16100779 |
| Journal: | Nucleic acids research |
| Year: | 2008/10/3 |
| Title: | The Rice Annotation Project Database (RAP-DB): 2008 update. |
| PMID: | 18089549 |
| Journal: | Nature |
| Year: | 2003/7/18 |
| Title: | Improvement of the Oryza sativa Nipponbare reference genome using next generation sequence and optical map data. |
| PMID: | 24280374 |
| Journal: | Rice (New York, N.Y.) |
| Year: | 2005/8/11 |
| Title: | Collection, mapping, and annotation of over 28,000 cDNA clones from japonica rice. |
| PMID: | 12869764 |
| Journal: | The Plant journal : for cell and molecular biology |
| Year: | 2008/1/ |
| Title: | Isolation and characterization of a rice dwarf mutant with a defect in brassinosteroid biosynthesis. |
| PMID: | 12427982 |
| Journal: | Science (New York, N.Y.) |
| Year: | 2002/11/ |
| Title: | Castasterone is a likely end product of brassinosteroid biosynthetic pathway in rice. |
| PMID: | 18656444 |
| Journal: | Genome research |
| Year: |