Detail Information
P450 Protein:
| P450 Symbol | CYP302A1 |
| Protein Name | Cytochrome P450 302a1, mitochondrial (EC 1.14.15.44) (Protein disembodied) |
| Uniprot ID | Q9NGX9 |
| EC Number | 1.14.15.44 |
| Gene ID | 45282 |
| Species | Drosophila melanogaster (Fruit fly) |
| Txid | 7227 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C27H44O4 + Fe2S2 + O2 + H+ → C27H44O5 + Fe2S2 + H2O |
| Reaction Type | Oxidation |
| Chemical Bond | CH |
| RheaID | 82055 |
+
+
+
CYP302A1
+
+
Substrate Information:
| Substrate Name | 2,22-dideoxyecdysone |
| Substrate Chemical Formula | C27H44O4 |
| Substrate PubChem CID | 14017685 |
| Substrate Smiles | CC(CCCC(C)(C)O)C1CCC2(C1(CCC3C2=CC(=O)C4C3(CCC(C4)O)C)C)O |
| Substrate Structure |
| Substrate Name | [2Fe-2S]1+ |
| Substrate Chemical Formula | Fe2S2 |
| Substrate Smiles | S1[Fe]S[Fe+]1 |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
| Substrate Name | H+ |
| Substrate Chemical Formula | H+ |
| Substrate PubChem CID | 1038 |
| Substrate CAS Number | 12408-02-5 |
| Substrate Smiles | [H+] |
| Substrate Structure |
Product Information:
| Product Name | 2-deoxyecdysone |
| Product Chemical Formula | C27H44O5 |
| Product PubChem CID | 13939876 |
| Product Smiles | CC(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CCC(C4)O)C)C)O)C(CCC(C)(C)O)O |
| Product Structure |
| Product Name | [2Fe-2S]2+ |
| Product Chemical Formula | Fe2S2 |
| Product Smiles | S1[Fe+]S[Fe+]1 |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | The Drosophila disembodied gene controls late embryonic morphogenesis and codes for a cytochrome P450 enzyme that regulates embryonic ecdysone levels. |
| PMID: | 10976044 |
| Journal: | Proceedings of the National Academy of Sciences of the United States of America |
| Year: | 2002/1/ |
| Title: | The genome sequence of Drosophila melanogaster. |
| PMID: | 10731132 |
| Journal: | Mechanisms of development |
| Year: | 2000/10/ |
| Title: | Annotation of the Drosophila melanogaster euchromatic genome: a systematic review. |
| PMID: | 12537572 |
| Journal: | Genome biology |
| Year: | 2002/8/20 |
| Title: | Molecular and biochemical characterization of two P450 enzymes in the ecdysteroidogenic pathway of Drosophila melanogaster. |
| PMID: | 12177427 |
| Journal: | Science (New York, N.Y.) |
| Year: | 2003/11/25 |
| Title: | Regulation of glial cell number and differentiation by ecdysone and Fos signaling. |
| PMID: | 12676319 |
| Journal: | Development (Cambridge, England) |
| Year: | 2000/3/24 |
| Title: | Shade is the Drosophila P450 enzyme that mediates the hydroxylation of ecdysone to the steroid insect molting hormone 20-hydroxyecdysone. |
| PMID: | 14610274 |
| Journal: | |
| Year: | 2003/4/ |