Detail Information
P450 Protein:
| P450 Symbol | CYP89A9 |
| Protein Name | Cytochrome P450 89A9 (EC 1.14.14.-) |
| Uniprot ID | Q9SRQ1 |
| EC Number | 1.14.14.- |
| Gene ID | 821250 |
| Species | Arabidopsis thaliana (Mouse-ear cress) |
| Txid | 3702 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C35H39N4O7- + C17H21N4O9P-2 + O2 → C34H39N4O7- + CHO2- + C17H18N4O9P-3 + H+ |
| Reaction Type | Oxidation |
| Chemical Bond | C=O |
| RheaID | 67172 |
+
+
CYP89A9
+
+
+
Substrate Information:
| Substrate Name | primary fluorescent chlorophyll catabolite |
| Substrate Chemical Formula | C35H39N4O7- |
| Substrate PubChem CID | 91819909 |
| Substrate Smiles | CCC1=C(NC(=C1C)C=O)CC2=C(C3=C(N2)/C(=C4/[C@H]([C@@H](C(=N4)CC5C(=C(C(=O)N5)C=C)C)C)CCC(=O)[O-])/[C@H](C3=O)C(=O)OC)C |
| Substrate Structure |
| Substrate Name | FMNH2 |
| Substrate Chemical Formula | C17H21N4O9P-2 |
| Substrate PubChem CID | 44229161 |
| Substrate Smiles | CC1=CC2=C(C=C1C)N(C3=C(N2)C(=O)NC(=O)N3)C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
Product Information:
| Product Name | primary fluorescent dioxobilin-type chlorophyll catabolite |
| Product Chemical Formula | C34H39N4O7- |
| Product PubChem CID | 155818823 |
| Product Smiles | CCC1=C(C(=O)NC1CC2=C(C3=C(N2)C(=C4C(C(C(=N4)CC5C(=C(C(=O)N5)C=C)C)C)CCC(=O)[O-])C(C3=O)C(=O)OC)C)C |
| Product Structure |
| Product Name | formate |
| Product Chemical Formula | CHO2- |
| Product PubChem CID | 283 |
| Product CAS Number | 71-47-6 |
| Product Smiles | C(=O)[O-] |
| Product Structure |
| Product Name | FMN |
| Product Chemical Formula | C17H18N4O9P-3 |
| Product PubChem CID | 44229199 |
| Product Smiles | CC1=CC2=C(C=C1C)N(C3=NC(=NC(=O)C3=N2)[O-])C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Product Structure |
| Product Name | H+ |
| Product Chemical Formula | H+ |
| Product PubChem CID | 1038 |
| Product CAS Number | 12408-02-5 |
| Product Smiles | [H+] |
| Product Structure |
References:
| Title: | Sequence and analysis of chromosome 3 of the plant Arabidopsis thaliana. |
| PMID: | 11130713 |
| Journal: | The Plant cell |
| Year: | 2017/2/ |
| Title: | Araport11: a complete reannotation of the Arabidopsis thaliana reference genome. |
| PMID: | 27862469 |
| Journal: | Chemistry (Weinheim an der Bergstrasse, Germany) |
| Year: | 2003/10/31 |
| Title: | Empirical analysis of transcriptional activity in the Arabidopsis genome. |
| PMID: | 14593172 |
| Journal: | Nature |
| Year: | 2000/12/14 |
| Title: | Chlorophyll breakdown in higher plants. |
| PMID: | 21167811 |
| Journal: | The Plant journal : for cell and molecular biology |
| Year: | 2011/8/ |
| Title: | Cytochrome P450 CYP89A9 is involved in the formation of major chlorophyll catabolites during leaf senescence in Arabidopsis. |
| PMID: | 23723324 |
| Journal: | Biochimica et biophysica acta |
| Year: | 2014/1/3 |
| Title: | Hydroxymethylated phyllobilins: a puzzling new feature of the dioxobilin branch of chlorophyll breakdown. |
| PMID: | 24302623 |
| Journal: | Science (New York, N.Y.) |
| Year: | 2013/5/ |