P450 Protein:
| P450 Symbol | |
| Protein Name | Linoleate diol synthase (LDS) (Linoleate (8R)-dioxygenase) (Linoleate 8-dioxygenase) [Includes: Linoleate 8R-lipoxygenase (EC 1.13.11.60); 9,12-octadecadienoate 8-hydroperoxide 8R-isomerase (EC 5.4.4.6)] |
| Uniprot ID | Q9UUS2 |
| EC Number | 1.13.11.60; 5.4.4.6 |
| Species | Gaeumannomyces graminis (Turf grass take-all root rot fungus) (Rhaphidophora graminis) |
| Txid | 29850 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C18H32O4 → C18H32O4 |
| Reaction Type | Elimination |
| Chemical Bond | |
| RheaID | 25399 |
Substrate Information:
| Substrate Name | (8R,9Z,12Z)-8-hydroperoxyoctadeca-9,12-dienoate |
| Substrate Chemical Formula | C18H32O4 |
| Substrate PubChem CID | 6438758 |
| Substrate Smiles | CCCCCC=CCC=CC(CCCCCCC(=O)O)OO |
| Substrate Structure |
Product Information:
| Product Name | (7S,8S,9Z,12Z)-7,8-dihydroxyoctadeca-9,12-dienoate |
| Product Chemical Formula | C18H32O4 |
| Product PubChem CID | 5460412 |
| Product Smiles | CCCCCC=CCC=CC(C(CCCCCC(=O)O)O)O |
| Product Structure |
References:
| Title: | Cloning of linoleate diol synthase reveals homology with prostaglandin H synthases. |
| PMID: | 10497176 |
| Journal: | The Journal of biological chemistry |
| Year: | 1999/10/1 |
| Title: | Purification and characterization of linoleate 8-dioxygenase from the fungus Gaeumannomyces graminis as a novel hemoprotein. |
| PMID: | 8662736 |
| Journal: | |
| Year: | 1996/6/14 |