Detail Information
P450 Protein:
| P450 Symbol | Cyp306a1 |
| Protein Name | Cytochrome P450 306a1 (CYPCCCVIA1) (EC 1.14.15.-) (Protein phantom) (Dmphm) |
| Uniprot ID | Q9VWR5 |
| EC Number | 1.14.15.- |
| Gene ID | 32857 |
| Species | Drosophila melanogaster (Fruit fly) |
| Txid | 7227 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C27H44O3 + Fe2S2 + O2 + H+ → C27H44O4 + Fe2S2 + H2O |
| Reaction Type | Oxidation |
| Chemical Bond | CH |
| RheaID | 82347 |
+
+
+
Cyp306a1
+
+
Substrate Information:
| Substrate Name | 2,22,25-trideoxyecdysone |
| Substrate Chemical Formula | C27H44O3 |
| Substrate PubChem CID | 15942885 |
| Substrate Smiles | CC(C)CCCC(C)C1CCC2(C1(CCC3C2=CC(=O)C4C3(CCC(C4)O)C)C)O |
| Substrate Structure |
| Substrate Name | [2Fe-2S]1+ |
| Substrate Chemical Formula | Fe2S2 |
| Substrate Smiles | S1[Fe]S[Fe+]1 |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
| Substrate Name | H+ |
| Substrate Chemical Formula | H+ |
| Substrate PubChem CID | 1038 |
| Substrate CAS Number | 12408-02-5 |
| Substrate Smiles | [H+] |
| Substrate Structure |
Product Information:
| Product Name | 2,22-dideoxyecdysone |
| Product Chemical Formula | C27H44O4 |
| Product PubChem CID | 14017685 |
| Product Smiles | CC(CCCC(C)(C)O)C1CCC2(C1(CCC3C2=CC(=O)C4C3(CCC(C4)O)C)C)O |
| Product Structure |
| Product Name | [2Fe-2S]2+ |
| Product Chemical Formula | Fe2S2 |
| Product Smiles | S1[Fe+]S[Fe+]1 |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Phantom encodes the 25-hydroxylase of Drosophila melanogaster and Bombyx mori: a P450 enzyme critical in ecdysone biosynthesis. |
| PMID: | 15350618 |
| Journal: | Genome biology |
| Year: | 2004/9/ |
| Title: | Genome scans of variation and adaptive change: extended analysis of a candidate locus close to the phantom gene region in Drosophila melanogaster. |
| PMID: | 17322555 |
| Journal: | Science (New York, N.Y.) |
| Year: | 2000/3/24 |
| Title: | The genome sequence of Drosophila melanogaster. |
| PMID: | 10731132 |
| Journal: | Molecular biology and evolution |
| Year: | 2007/5/ |
| Title: | Annotation of the Drosophila melanogaster euchromatic genome: a systematic review. |
| PMID: | 12537572 |
| Journal: | Insect biochemistry and molecular biology |
| Year: | 2002/1/ |
| Title: | A Drosophila full-length cDNA resource. |
| PMID: | 12537569 |
| Journal: | |
| Year: |