P450 Protein:
| P450 Symbol | CYP50918A1 |
| Protein Name | Mitochondrial hydroperoxide bicyclase CYP50918A1 (EC 4.2.1.-) (Cytochrome P450 50918A1) |
| Uniprot ID | A0A0G4IRM5 |
| EC Number | 4.2.1.- |
| Species | Plasmodiophora brassicae (Clubroot disease agent) |
| Txid | 37360 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C18H29O4- → C18H29O4- |
| Reaction Type | Cyclization |
| Chemical Bond | C=C |
| RheaID | 75603 |
CYP50918A1
Substrate Information:
| Substrate Name | (13S)-hydroperoxy-(9Z,11E,15Z)-octadecatrienoate |
| Substrate Chemical Formula | C18H29O4- |
| Substrate PubChem CID | 45266757 |
| Substrate Smiles | CCC=CCC(C=CC=CCCCCCCCC(=O)[O-])OO |
| Substrate Structure |
Product Information:
| Product Name | plasmodiophorol A |
| Product Chemical Formula | C18H29O4- |
| Product PubChem CID | 168007594 |
| Product Smiles | CCC(C1CC2C(C1C=CCCCCCCCC(=O)[O-])O2)O |
| Product Structure |
References:
| Title: | The Plasmodiophora brassicae genome reveals insights in its life cycle and ancestry of chitin synthases. |
| PMID: | 26084520 |
| Journal: | Scientific reports |
| Year: | 2021/12/ |
| Title: | The architecture of the Plasmodiophora brassicae nuclear and mitochondrial genomes. |
| PMID: | 31673019 |
| Journal: | Biochimica et biophysica acta. Molecular and cell biology of lipids |
| Year: | 2022/4/6 |
| Title: | Author Correction: The architecture of the?Plasmodiophora brassicae?nuclear and mitochondrial genomes. |
| PMID: | 35388094 |
| Journal: | |
| Year: | 2019/10/31 |
| Title: | Hydroperoxide bicyclase CYP50918A1 of Plasmodiophora brassicae (Rhizaria, SAR): Detection of novel enzyme of oxylipin biosynthesis. |
| PMID: | 34450267 |
| Journal: | |
| Year: | 2015/6/18 |