Detail Information
P450 Protein:
| P450 Symbol | sphH |
| Protein Name | Cytochrome P450 monooxygenase sphH (EC 1.-.-.-) (Sphingofungin biosynthesis cluster protein H) |
| Uniprot ID | B0XZV0 |
| EC Number | 1.-.-.- |
| Species | Aspergillus fumigatus (strain CBS 144.89 / FGSC A1163 / CEA10) (Neosartorya fumigata) |
| Txid | 451804 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C20H37NO4 + C17H21N4O9P-2 + O2 → C20H39NO5 + C17H18N4O9P-3 + H2O + H+ |
| Reaction Type | Oxidation |
| Chemical Bond | CH |
| RheaID | 81163 |
+
+
sphH
+
+
+
Substrate Information:
| Substrate Name | presphingofungin |
| Substrate Chemical Formula | C20H37NO4 |
| Substrate PubChem CID | 172407769 |
| Substrate Smiles | CCCCCCCC=CCCCCC=CC(CC(C(C(=O)[O-])[NH3+])O)O |
| Substrate Structure |
| Substrate Name | FMNH2 |
| Substrate Chemical Formula | C17H21N4O9P-2 |
| Substrate PubChem CID | 44229161 |
| Substrate Smiles | CC1=CC2=C(C=C1C)N(C3=C(N2)C(=O)NC(=O)N3)C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
Product Information:
| Product Name | sphingofungin B1 |
| Product Chemical Formula | C20H39NO5 |
| Product PubChem CID | 172407771 |
| Product Smiles | CCCCCCC(CCCCCCC=CC(CC(C(C(=O)[O-])[NH3+])O)O)O |
| Product Structure |
| Product Name | FMN |
| Product Chemical Formula | C17H18N4O9P-3 |
| Product PubChem CID | 44229199 |
| Product Smiles | CC1=CC2=C(C=C1C)N(C3=NC(=NC(=O)C3=N2)[O-])C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
| Product Name | H+ |
| Product Chemical Formula | H+ |
| Product PubChem CID | 1038 |
| Product CAS Number | 12408-02-5 |
| Product Smiles | [H+] |
| Product Structure |
References:
| Title: | Genomic islands in the pathogenic filamentous fungus Aspergillus fumigatus. |
| PMID: | 18404212 |
| Journal: | ACS chemical biology |
| Year: | 1992/6/ |
| Title: | Sphingofungins A, B, C, and D |
| PMID: | 1500351 |
| Journal: | The Journal of antibiotics |
| Year: | 2022/2/18 |
| Title: | a new family of antifungal agents. I. Fermentation, isolation, and biological activity. |
| PMID: | 35023724 |
| Journal: | PLoS genetics |
| Year: | 2008/4/11 |
| Title: | Biosynthesis of the Sphingolipid Inhibitors Sphingofungins in Filamentous Fungi Requires Aminomalonate as a Metabolic Precursor. |
| Identifier: | N/A |
| Journal: | |
| Year: |