Detail Information
P450 Protein:
| P450 Symbol | gsfF |
| Protein Name | Cytochrome P450 monooxygenase gsfF (EC 1.-.-.-) (Griseofulvin synthesis protein F) |
| Uniprot ID | D7PI20 |
| EC Number | 1.-.-.- |
| Species | Penicillium aethiopicum |
| Txid | 36650 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C16H15ClO6 + C17H21N4O9P-2 + O2 + H+ → C16H13ClO6 + C17H18N4O9P-3 + H2O |
| Reaction Type | Oxidation |
| Chemical Bond | CH |
| RheaID | 73935 |
+
+
+
gsfF
+
+
Substrate Information:
| Substrate Name | griseophenone B |
| Substrate Chemical Formula | C16H15ClO6 |
| Substrate PubChem CID | 23872096 |
| Substrate Smiles | CC1=CC(=CC(=C1C(=O)C2=C(C(=C(C=C2O)OC)Cl)O)OC)O |
| Substrate Structure |
| Substrate Name | FMNH2 |
| Substrate Chemical Formula | C17H21N4O9P-2 |
| Substrate PubChem CID | 44229161 |
| Substrate Smiles | CC1=CC2=C(C=C1C)N(C3=C(N2)C(=O)NC(=O)N3)C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
| Substrate Name | H+ |
| Substrate Chemical Formula | H+ |
| Substrate PubChem CID | 1038 |
| Substrate CAS Number | 12408-02-5 |
| Substrate Smiles | [H+] |
| Substrate Structure |
Product Information:
| Product Name | desmethyl-dehydrogriseofulvin |
| Product Chemical Formula | C16H13ClO6 |
| Product PubChem CID | 91820110 |
| Product Smiles | CC1=CC(=O)C=C(C12C(=O)C3=C(O2)C(=C(C=C3O)OC)Cl)OC |
| Product Structure |
| Product Name | FMN |
| Product Chemical Formula | C17H18N4O9P-3 |
| Product PubChem CID | 44229199 |
| Product Smiles | CC1=CC2=C(C=C1C)N(C3=NC(=NC(=O)C3=N2)[O-])C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Identification of the viridicatumtoxin and griseofulvin gene clusters from Penicillium aethiopicum. |
| PMID: | 20534346 |
| Journal: | ACS chemical biology |
| Year: | 2013/10/18 |
| Title: | Experimental ringworm in guinea pigs: oral treatment with griseofulvin. |
| PMID: | 13577889 |
| Journal: | Nature |
| Year: | 2010/5/28 |
| Title: | Griseofulvin inhibits fungal mitosis. |
| PMID: | 4583105 |
| Journal: | Chemistry & biology |
| Year: | 1973/8/3 |
| Title: | Complexity generation in fungal polyketide biosynthesis: a spirocycle-forming P450 in the concise pathway to the antifungal drug griseofulvin. |
| PMID: | 23978092 |
| Journal: | |
| Year: | 1958/8/16 |