P450 Protein:
| P450 Symbol | FOXB_03425 |
| Protein Name | Bifunctional dioxygenase (DOX)-epoxy alcohol synthase (EAS) (10R-DOX-EAS) [Includes: Fatty acid alpha-dioxygenase (DOX) (EC 1.13.11.-) (EC 1.13.11.62); Epoxy alcohol synthase (EAS) (EC 1.-.-.-) (Cytochrome P450 monooxygenase) (CYP)] |
| Uniprot ID | F9FAJ9 |
| EC Number | 1.-.-.-; 1.13.11.-; 1.13.11.62 |
| Species | Fusarium oxysporum (strain Fo5176) (Fusarium vascular wilt) |
| Txid | 660025 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C18H31O2- + O2 → C18H31O4- |
| Reaction Type | Cyclization |
| Chemical Bond | C=C |
| RheaID | 31695 |
FOXB_03425
Substrate Information:
| Substrate Name | (9Z,12Z)-octadecadienoate |
| Substrate Chemical Formula | C18H31O2- |
| Substrate PubChem CID | 5460332 |
| Substrate Smiles | CCCCCC=CCC=CCCCCCCCC(=O)[O-] |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
Product Information:
| Product Name | (8E,10R,12Z)-10-hydroperoxyoctadeca-8,12-dienoate |
| Product Chemical Formula | C18H31O4- |
| Product PubChem CID | 56927724 |
| Product Smiles | CCCCCC=CCC(C=CCCCCCCC(=O)[O-])OO |
| Product Structure |
References:
| Title: | A highly conserved effector in Fusarium oxysporum is required for full virulence on Arabidopsis. |
| PMID: | 21942452 |
| Journal: | Journal of lipid research |
| Year: | 2012/2/ |
| Title: | Epoxy alcohol synthase of the rice blast fungus represents a novel subfamily of dioxygenase-cytochrome P450 fusion enzymes. |
| PMID: | 25121983 |
| Journal: | Molecular plant-microbe interactions : MPMI |
| Year: | 2014/10/ |