P450 Protein:
| P450 Symbol | AOS1 |
| Protein Name | Allene oxide synthase 1, chloroplastic (LeAOS1) (EC 4.2.1.92) (Cytochrome P450 74A) (Hydroperoxide dehydratase) |
| Uniprot ID | K4BV52 |
| EC Number | 4.2.1.92 |
| Gene ID | 606711 |
| Species | Solanum lycopersicum (Tomato) (Lycopersicon esculentum) |
| Txid | 4081 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C18H29O4- → C18H27O3- + H2O |
| Reaction Type | Reduction |
| Chemical Bond | O-O |
| RheaID | 25074 |
AOS1
Substrate Information:
| Substrate Name | (13S)-hydroperoxy-(9Z,11E,15Z)-octadecatrienoate |
| Substrate Chemical Formula | C18H29O4- |
| Substrate PubChem CID | 45266757 |
| Substrate Smiles | CCC=CCC(C=CC=CCCCCCCCC(=O)[O-])OO |
| Substrate Structure |
Product Information:
| Product Name | (9Z,13S,15Z)-12,13-epoxyoctadeca-9,11,15-trienoate |
| Product Chemical Formula | C18H27O3- |
| Product PubChem CID | 16069997 |
| Product Smiles | CCC=CCC1C(=CC=CCCCCCCCC(=O)[O-])O1 |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Expression of allene oxide synthase determines defense gene activation in tomato. |
| PMID: | 10759530 |
| Journal: | Nature |
| Year: | 2012/5/30 |
| Title: | The tomato genome sequence provides insights into fleshy fruit evolution. |
| PMID: | 22660326 |
| Journal: | The Journal of biological chemistry |
| Year: | 2002/11/29 |
| Title: | Identification of a jasmonate-regulated allene oxide synthase that metabolizes 9-hydroperoxides of linoleic and linolenic acids. |
| PMID: | 12351632 |
| Journal: | Plant physiology |
| Year: | 2000/4/ |