Detail Information
P450 Protein:
| P450 Symbol | atE |
| Protein Name | Cytochrome P450 monooxygenase atE (EC 1.14.-.-) (Terreic acid biosynthesis cluster protein E) |
| Uniprot ID | Q0CJ57 |
| EC Number | 1.14.-.- |
| Gene ID | 4322101 |
| Species | Aspergillus terreus (strain NIH 2624 / FGSC A1156) |
| Txid | 341663 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C7H8O2 + C17H21N4O9P-2 + O2 → C7H8O3 + R + H2O |
| Reaction Type | Oxidation |
| Chemical Bond | CH |
| RheaID | 84151 |
+
+
atE
+
+
Substrate Information:
| Substrate Name | 3-methylcatechol |
| Substrate Chemical Formula | C7H8O2 |
| Substrate PubChem CID | 340 |
| Substrate Smiles | CC1=C(C(=CC=C1)O)O |
| Substrate Structure |
| Substrate Name | FMNH2 |
| Substrate Chemical Formula | C17H21N4O9P-2 |
| Substrate PubChem CID | 44229161 |
| Substrate Smiles | CC1=CC2=C(C=C1C)N(C3=C(N2)C(=O)NC(=O)N3)C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
Product Information:
| Product Name | 3-methylbenzene-1,2,4-triol |
| Product Chemical Formula | C7H8O3 |
| Product PubChem CID | 197042 |
| Product Smiles | CC1=C(C=CC(=C1O)O)O |
| Product Structure |
| Product Name | A |
| Product Chemical Formula | R |
| Product Smiles | * |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Heterologous pathway assembly reveals molecular steps of fungal terreic acid biosynthesis. |
| PMID: | 29391515 |
| Journal: | Journal of biotechnology |
| Year: | 1996/11/27 |
| Title: | Cloning of the polyketide synthase gene atX from Aspergillus terreus and its identification as the 6-methylsalicylic acid synthase gene by heterologous expression. |
| PMID: | 9003280 |
| Journal: | Organic letters |
| Year: | 2014/4/10 |
| Title: | Polyketide synthase gene pksM from Aspergillus terreus expressed during growth phase. |
| PMID: | 9438344 |
| Journal: | Proceedings of the National Academy of Sciences of the United States of America |
| Year: | 2018/2/1 |
| Title: | Terreic acid, a quinone epoxide inhibitor of Bruton's tyrosine kinase. |
| PMID: | 10051623 |
| Journal: | Folia microbiologica |
| Year: | 1997/1/ |
| Title: | Differential antibacterial properties of the MurA inhibitors terreic acid and fosfomycin. |
| PMID: | 23686727 |
| Journal: | Scientific reports |
| Year: | 2014/4/ |
| Title: | Culture-based and sequence-based insights into biosynthesis of secondary metabolites by Aspergillus terreus ATCC 20542. |
| PMID: | 24534845 |
| Journal: | Journal of basic microbiology |
| Year: | 2014/10/17 |
| Title: | Molecular genetic characterization of terreic acid pathway in Aspergillus terreus. |
| PMID: | 25265334 |
| Journal: | Molecular & general genetics : MGG |
| Year: | 1999/3/2 |