P450 Protein:
| P450 Symbol | ftmP450-2 |
| Protein Name | Fumitremorgin C synthase (EC 1.14.19.71) (Cytochrome P450 monooxygenase ftmP450-2) (Fumitremorgin biosynthesis protein E) |
| Uniprot ID | Q4WAW8 |
| EC Number | 1.14.19.71 |
| Gene ID | 3504529 |
| Species | Aspergillus fumigatus (strain ATCC MYA-4609 / CBS 101355 / FGSC A1100 / Af293) (Neosartorya fumigata) |
| Txid | 330879 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C22H27N3O3 + C17H21N4O9P-2 + O2 → C22H25N3O3 + C17H18N4O9P-3 + H2O + H+ |
| Reaction Type | Oxidation |
| Chemical Bond | CH |
| RheaID | 35963 |
ftmP450-2
Substrate Information:
| Substrate Name | tryprostatin A |
| Substrate Chemical Formula | C22H27N3O3 |
| Substrate PubChem CID | 9929833 |
| Substrate Smiles | CC(=CCC1=C(C2=C(N1)C=C(C=C2)OC)CC3C(=O)N4CCCC4C(=O)N3)C |
| Substrate Structure |
| Substrate Name | FMNH2 |
| Substrate Chemical Formula | C17H21N4O9P-2 |
| Substrate PubChem CID | 44229161 |
| Substrate Smiles | CC1=CC2=C(C=C1C)N(C3=C(N2)C(=O)NC(=O)N3)C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
Product Information:
| Product Name | fumitremorgin C |
| Product Chemical Formula | C22H25N3O3 |
| Product PubChem CID | 403923 |
| Product Smiles | CC(=CC1C2=C(CC3N1C(=O)C4CCCN4C3=O)C5=C(N2)C=C(C=C5)OC)C |
| Product Structure |
| Product Name | FMN |
| Product Chemical Formula | C17H18N4O9P-3 |
| Product PubChem CID | 44229199 |
| Product Smiles | CC1=CC2=C(C=C1C)N(C3=NC(=NC(=O)C3=N2)[O-])C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
| Product Name | H+ |
| Product Chemical Formula | H+ |
| Product PubChem CID | 1038 |
| Product CAS Number | 12408-02-5 |
| Product Smiles | [H+] |
| Product Structure |
References:
| Title: | Genomic sequence of the pathogenic and allergenic filamentous fungus Aspergillus fumigatus. |
| PMID: | 16372009 |
| Journal: | Journal of the American Chemical Society |
| Year: | 2005/7/ |
| Title: | Overproduction, purification and characterization of FtmPT1, a brevianamide F prenyltransferase from Aspergillus fumigatus. |
| PMID: | 16000710 |
| Journal: | Microbiology (Reading, England) |
| Year: | 2010/12/22 |
| Title: | The fumitremorgin gene cluster of Aspergillus fumigatus: identification of a gene encoding brevianamide F synthetase. |
| PMID: | 16755625 |
| Journal: | Nature |
| Year: | 2009/10/7 |
| Title: | FtmPT2, an N-prenyltransferase from Aspergillus fumigatus, catalyses the last step in the biosynthesis of fumitremorgin B. |
| PMID: | 18683158 |
| Journal: | Chembiochem : a European journal of chemical biology |
| Year: | 2008/9/1 |
| Title: | Identification of cytochrome P450s required for fumitremorgin biosynthesis in Aspergillus fumigatus. |
| PMID: | 19226505 |
| Journal: | Organic & biomolecular chemistry |
| Year: | 2009/3/23 |
| Title: | FtmOx1, a non-heme Fe(II) and alpha-ketoglutarate-dependent dioxygenase, catalyses the endoperoxide formation of verruculogen in Aspergillus fumigatus. |
| PMID: | 19763315 |
| Journal: | Bioscience, biotechnology, and biochemistry |
| Year: | 2012/12/14 |
| Title: | Structure-function analysis of an enzymatic prenyl transfer reaction identifies a reaction chamber with modifiable specificity. |
| PMID: | 21105662 |
| Journal: | |
| Year: | 2005/12/22 |
| Title: | Breaking the regioselectivity of indole prenyltransferases: identification of regular C3-prenylated hexahydropyrrolo[2,3-b]indoles as side products of the regular C2-prenyltransferase FtmPT1. |
| PMID: | 23090579 |
| Journal: | |
| Year: | 2006/7/ |
| Title: | A point mutation in ftmD blocks the fumitremorgin biosynthetic pathway in Aspergillus fumigatus strain Af293. |
| PMID: | 23649274 |
| Journal: | |
| Year: | 2013/1/ |