Detail Information
P450 Protein:
| P450 Symbol | CYP74A2 |
| Protein Name | Allene oxide synthase 2 (EC 4.2.1.92) (Cytochrome P450 74A2) (Hydroperoxide dehydratase 2) |
| Uniprot ID | Q7XYS3 |
| EC Number | 4.2.1.92 |
| Species | Oryza sativa subsp. japonica (Rice) |
| Txid | 39947 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C18H29O4- → C18H27O3- + H2O |
| Reaction Type | Reduction |
| Chemical Bond | O-O |
| RheaID | 25074 |
CYP74A2
+
Substrate Information:
| Substrate Name | (13S)-hydroperoxy-(9Z,11E,15Z)-octadecatrienoate |
| Substrate Chemical Formula | C18H29O4- |
| Substrate PubChem CID | 45266757 |
| Substrate Smiles | CCC=CCC(C=CC=CCCCCCCCC(=O)[O-])OO |
| Substrate Structure |
Product Information:
| Product Name | (9Z,13S,15Z)-12,13-epoxyoctadeca-9,11,15-trienoate |
| Product Chemical Formula | C18H27O3- |
| Product PubChem CID | 16069997 |
| Product Smiles | CCC=CCC1C(=CC=CCCCCCCCC(=O)[O-])O1 |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Molecular characterization of the gene encoding rice allene oxide synthase and its expression. |
| PMID: | 12596875 |
| Journal: | Plant & cell physiology |
| Year: | 2002/12/ |
| Title: | Sequence, annotation, and analysis of synteny between rice chromosome 3 and diverged grass species. |
| PMID: | 16109971 |
| Journal: | Nucleic acids research |
| Year: | 2005/9/ |
| Title: | The map-based sequence of the rice genome. |
| PMID: | 16100779 |
| Journal: | Nature |
| Year: | 2013/2/6 |
| Title: | The Rice Annotation Project Database (RAP-DB): 2008 update. |
| PMID: | 18089549 |
| Journal: | Rice (New York, N.Y.) |
| Year: | 2004/2/ |
| Title: | Improvement of the Oryza sativa Nipponbare reference genome using next generation sequence and optical map data. |
| PMID: | 24280374 |
| Journal: | Science (New York, N.Y.) |
| Year: | 2003/7/18 |
| Title: | Collection, mapping, and annotation of over 28,000 cDNA clones from japonica rice. |
| PMID: | 12869764 |
| Journal: | Genome research |
| Year: | 2005/8/11 |
| Title: | Phytochrome-mediated transcriptional up-regulation of ALLENE OXIDE SYNTHASE in rice seedlings. |
| PMID: | 14988482 |
| Journal: | Bioscience, biotechnology, and biochemistry |
| Year: | 2008/1/ |