Detail Information
P450 Protein:
| P450 Symbol | cotB3 |
| Protein Name | Cyclooctat-9-en-7-ol 5-monooxygenase (EC 1.14.99.61) |
| Uniprot ID | C9K1X6 |
| EC Number | 1.14.99.61 |
| Species | Streptomyces melanosporofaciens |
| Txid | 67327 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C20H34O + RH2 + O2 → C20H34O2 + R + H2O |
| Reaction Type | Oxidation |
| Chemical Bond | CH |
| RheaID | 56820 |
+
+
cotB3
+
+
Substrate Information:
| Substrate Name | cyclooctat-9-en-7-ol |
| Substrate Chemical Formula | C20H34O |
| Substrate PubChem CID | 132282046 |
| Substrate Smiles | CC1CCC2C1CC3(CCC(C3=CCC2(C)O)C(C)C)C |
| Substrate Structure |
| Substrate Name | AH2 |
| Substrate Chemical Formula | RH2 |
| Substrate Smiles | *([H])[H] |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
Product Information:
| Product Name | cyclooctat-9-ene-5,7-diol |
| Product Chemical Formula | C20H34O2 |
| Product PubChem CID | 90658403 |
| Product Smiles | CC1CC(C2C1CC3(CCC(C3=CCC2(C)O)C(C)C)C)O |
| Product Structure |
| Product Name | A |
| Product Chemical Formula | R |
| Product Smiles | * |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Cloning and heterologous expression of the cyclooctatin biosynthetic gene cluster afford a diterpene cyclase and two p450 hydroxylases. |
| PMID: | 19635410 |
| Journal: | Microbial cell factories |
| Year: | 2009/7/31 |
| Title: | Identification, characterization and molecular adaptation of class I redox systems for the production of hydroxylated diterpenoids. |
| PMID: | 27216162 |
| Journal: | Chemistry & biology |
| Year: | 2016/5/23 |