Detail Information
P450 Protein:
| P450 Symbol | iliC |
| Protein Name | Cytochrome P450 monooxygenase iliC (EC 1.-.-.-) (Ilicicolin H biosynthesis cluster protein C) |
| Uniprot ID | G0REX9 |
| EC Number | 1.-.-.- |
| Gene ID | 18486391 |
| Species | Hypocrea jecorina (strain QM6a) (Trichoderma reesei) |
| Txid | 431241 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C27H32NO4- + C17H21N4O9P-2 + O2 → C27H31NO4 + C17H18N4O9P-3 + H2O |
| Reaction Type | Oxidation |
| Chemical Bond | C-OH;C=C |
| RheaID | 64552 |
+
+
iliC
+
+
Substrate Information:
| Substrate Name | (3E,5S)-3-[(2E,4E,8S,10E,12Z)-1-hydroxy-4,8-dimethyltetradeca-2,4,10,12-tetraen-1-ylidene]-5-[(4-hydroxyphenyl)methyl]pyrrolidine-2,4-dione |
| Substrate Chemical Formula | C27H32NO4- |
| Substrate PubChem CID | 146672904 |
| Substrate Smiles | CC=CC=CCC(C)CCC=C(C)C=CC(=C1C(=O)C(NC1=O)CC2=CC=C(C=C2)O)[O-] |
| Substrate Structure |
| Substrate Name | FMNH2 |
| Substrate Chemical Formula | C17H21N4O9P-2 |
| Substrate PubChem CID | 44229161 |
| Substrate Smiles | CC1=CC2=C(C=C1C)N(C3=C(N2)C(=O)NC(=O)N3)C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
Product Information:
| Product Name | 3-[(2E,4E,8S,10E,12Z)-4,8-dimethyltetradeca-2,4,10,12-tetraenoyl]-4-hydroxy-5-(4-hydroxyphenyl)-1,2-dihydropyridin-2-one |
| Product Chemical Formula | C27H31NO4 |
| Product PubChem CID | 146672903 |
| Product Smiles | CC=CC=CCC(C)CCC=C(C)C=CC(=O)C1=C(C(=CNC1=O)C2=CC=C(C=C2)O)O |
| Product Structure |
| Product Name | FMN |
| Product Chemical Formula | C17H18N4O9P-3 |
| Product PubChem CID | 44229199 |
| Product Smiles | CC1=CC2=C(C=C1C)N(C3=NC(=NC(=O)C3=N2)[O-])C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | Genome sequencing and analysis of the biomass-degrading fungus Trichoderma reesei (syn. Hypocrea jecorina). |
| PMID: | 18454138 |
| Journal: | Journal of fungi (Basel, Switzerland) |
| Year: | 2021/12/1 |
| Title: | Trichoderma reesei Contains a Biosynthetic Gene Cluster That Encodes the Antifungal Agent Ilicicolin H. |
| PMID: | 34947016 |
| Journal: | Nature biotechnology |
| Year: | 2008/5/ |