Detail Information
P450 Protein:
| P450 Symbol | milC |
| Protein Name | Cytochrome P450 monooxygenase milC (EC 1.-.-.-) (Cordypyrones biosynthesis cluster protein C) |
| Uniprot ID | G3JUI6 |
| EC Number | 1.-.-.- |
| Gene ID | 18171347 |
| Species | Cordyceps militaris (strain CM01) (Caterpillar fungus) |
| Txid | 983644 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C22H28O3 + C17H21N4O9P-2 + O2 → C22H28O4 + C17H18N4O9P-3 + H2O + H+ |
| Reaction Type | Oxidation |
| Chemical Bond | CH |
| RheaID | 71079 |
+
+
milC
+
+
+
Substrate Information:
| Substrate Name | cordypyrone A |
| Substrate Chemical Formula | C22H28O3 |
| Substrate PubChem CID | 162680203 |
| Substrate Smiles | CC=CC=CC=CCCCCCCC=CC=CC1=CC(=CC(=O)O1)O |
| Substrate Structure |
| Substrate Name | FMNH2 |
| Substrate Chemical Formula | C17H21N4O9P-2 |
| Substrate PubChem CID | 44229161 |
| Substrate Smiles | CC1=CC2=C(C=C1C)N(C3=C(N2)C(=O)NC(=O)N3)C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
Product Information:
| Product Name | cordypyrone B |
| Product Chemical Formula | C22H28O4 |
| Product PubChem CID | 162680204 |
| Product Smiles | C1=C(C=C(OC1=O)C=CC=CCCCCCCC=CC=CC=CCO)O |
| Product Structure |
| Product Name | FMN |
| Product Chemical Formula | C17H18N4O9P-3 |
| Product PubChem CID | 44229199 |
| Product Smiles | CC1=CC2=C(C=C1C)N(C3=NC(=NC(=O)C3=N2)[O-])C[C@@H]([C@@H]([C@@H](COP(=O)([O-])[O-])O)O)O |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
| Product Name | H+ |
| Product Chemical Formula | H+ |
| Product PubChem CID | 1038 |
| Product CAS Number | 12408-02-5 |
| Product Smiles | [H+] |
| Product Structure |
References:
| Title: | Genome sequence of the insect pathogenic fungus Cordyceps militaris, a valued traditional Chinese medicine. |
| PMID: | 22112802 |
| Journal: | Genome biology |
| Year: | 2011/11/23 |
| Title: | Heterologous expression of a natural product biosynthetic gene cluster from Cordyceps militaris. |
| PMID: | 34548637 |
| Journal: | The Journal of antibiotics |
| Year: | 2022/1/ |