Detail Information
P450 Protein:
| P450 Symbol | nocL |
| Protein Name | Nocardicin C N-oxygenase (EC 1.14.15.43) |
| Uniprot ID | Q5J1R4 |
| EC Number | 1.14.15.43 |
| Species | Nocardia uniformis subsp. tsuyamanensis |
| Txid | 96045 |
| P450 Protein Structure |
Model Confidence (pLDDT)
Very high (>90)
High (90 > 70)
Low (70 > 50)
Very low (<50)
|
| Subcellular Location | |
| Protein Sequence | GO |
Reaction Scheme:
| Chemical Conversion | C23H26N4O8 + Fe2S2 + O2 + H+ → C23H24N4O9 + Fe2S2 + H2O |
| Reaction Type | Oxidation |
| Chemical Bond | N-H |
| RheaID | 82031 |
+
+
+
nocL
+
+
Substrate Information:
| Substrate Name | nocardicin C |
| Substrate Chemical Formula | C23H26N4O8 |
| Substrate PubChem CID | 3042313 |
| Substrate Smiles | C1C(C(=O)N1C(C2=CC=C(C=C2)O)C(=O)O)NC(=O)C(C3=CC=C(C=C3)OCCC(C(=O)O)N)N |
| Substrate Structure |
| Substrate Name | [2Fe-2S]1+ |
| Substrate Chemical Formula | Fe2S2 |
| Substrate Smiles | S1[Fe]S[Fe+]1 |
| Substrate Structure |
| Substrate Name | O2 |
| Substrate Chemical Formula | O2 |
| Substrate PubChem CID | 977 |
| Substrate CAS Number | 7782-44-7 |
| Substrate Smiles | O=O |
| Substrate Structure |
| Substrate Name | H+ |
| Substrate Chemical Formula | H+ |
| Substrate PubChem CID | 1038 |
| Substrate CAS Number | 12408-02-5 |
| Substrate Smiles | [H+] |
| Substrate Structure |
Product Information:
| Product Name | nocardicin A |
| Product Chemical Formula | C23H24N4O9 |
| Product PubChem CID | 6400657 |
| Product Smiles | C1C(C(=O)N1C(C2=CC=C(C=C2)O)C(=O)O)NC(=O)C(=NO)C3=CC=C(C=C3)OCCC(C(=O)O)N |
| Product Structure |
| Product Name | [2Fe-2S]2+ |
| Product Chemical Formula | Fe2S2 |
| Product Smiles | S1[Fe+]S[Fe+]1 |
| Product Structure |
| Product Name | H2O |
| Product Chemical Formula | H2O |
| Product PubChem CID | 962 |
| Product CAS Number | 7732-18-5 |
| Product Smiles | O |
| Product Structure |
References:
| Title: | The biosynthetic gene cluster for a monocyclic beta-lactam antibiotic, nocardicin A. |
| PMID: | 15271351 |
| Journal: | Journal of the American Chemical Society |
| Year: | 2005/1/ |
| Title: | Role of the cytochrome P450 NocL in nocardicin A biosynthesis. |
| PMID: | 12105888 |
| Journal: | Journal of bacteriology |
| Year: | 2004/7/ |
| Title: | Mutational analysis of nocK and nocL in the nocardicin a producer Nocardia uniformis. |
| PMID: | 15629944 |
| Journal: | Chemistry & biology |
| Year: | 2002/7/17 |